5-((2-(((1-(2,4-dichlorophenyl)ethylidene)hydrazono)methyl)phenyl)(methoxy)methyl)-3-methylisoxazole

ID: ALA2289396

PubChem CID: 76309365

Max Phase: Preclinical

Molecular Formula: C21H19Cl2N3O2

Molecular Weight: 416.31

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(c1cc(C)no1)c1ccccc1/C=N/N=C(\C)c1ccc(Cl)cc1Cl

Standard InChI:  InChI=1S/C21H19Cl2N3O2/c1-13-10-20(28-26-13)21(27-3)18-7-5-4-6-15(18)12-24-25-14(2)17-9-8-16(22)11-19(17)23/h4-12,21H,1-3H3/b24-12+,25-14+

Standard InChI Key:  UZKHASGTFIAKOX-OEIKEGJISA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   18.4120   -6.2988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6945   -6.7069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6926   -7.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4068   -7.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1245   -7.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1228   -6.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8366   -6.2936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5519   -6.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8350   -5.4685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5487   -5.0546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6373   -7.5299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4455   -7.7003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8561   -6.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3002   -6.3724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6761   -6.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4139   -5.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7004   -5.0597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7023   -4.2346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9887   -3.8205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9906   -2.9955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2733   -4.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7044   -2.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7066   -1.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9926   -1.3481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2748   -1.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2761   -2.5863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4175   -3.0023    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.9934   -0.5232    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 11 12  1  0
  8 11  1  0
 12 13  2  0
 13 14  1  0
 14  8  2  0
 13 15  1  0
  1 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 19 21  1  0
 20 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 20  1  0
 22 27  1  0
 24 28  1  0
M  END

Associated Targets(non-human)

Pseudoperonospora cubensis (1623 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Podosphaera fuliginea (1057 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.31Molecular Weight (Monoisotopic): 415.0854AlogP: 5.87#Rotatable Bonds: 6
Polar Surface Area: 59.98Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.39CX LogP: 4.57CX LogD: 4.57
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.37Np Likeness Score: -1.31

References

1. KAI H, ICHIBA T, OHTSUKA T, TAKASE A, MASUKO M.  (2000)  Synthesis and Fungicidal Activities of (-Methoxybenzyl) isoxazoles,  25  (3): [10.1584/jpestics.25.240]

Source