The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Flucythrinate ID: ALA2289397
Cas Number: 70124-77-5
PubChem CID: 50980
Product Number: F117642, Order Now?
Max Phase: Preclinical
Molecular Formula: C26H23F2NO4
Molecular Weight: 451.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1
Standard InChI: InChI=1S/C26H23F2NO4/c1-17(2)24(18-11-13-21(14-12-18)32-26(27)28)25(30)33-23(16-29)19-7-6-10-22(15-19)31-20-8-4-3-5-9-20/h3-15,17,23-24,26H,1-2H3
Standard InChI Key: GBIHOLCMZGAKNG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
5.5319 -4.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5308 -5.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2455 -6.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9620 -5.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9592 -4.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2438 -4.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2413 -3.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9545 -3.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5256 -3.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5231 -2.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8124 -3.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6702 -3.6705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9521 -2.4351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3835 -3.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0991 -3.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0997 -4.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8145 -4.8989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5288 -4.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5236 -3.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8083 -3.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3838 -2.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3814 -1.6078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2355 -3.2378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9526 -3.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9526 -4.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6689 -4.8756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3817 -4.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3736 -3.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6567 -3.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2453 -6.9778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5308 -7.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5306 -8.2151 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8164 -6.9774 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 9 1 0
9 10 1 0
9 11 1 0
8 12 1 0
8 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 3 0
14 21 1 0
19 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
3 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.47Molecular Weight (Monoisotopic): 451.1595AlogP: 6.63#Rotatable Bonds: 9Polar Surface Area: 68.55Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.64CX Basic pKa: ┄CX LogP: 6.77CX LogD: 6.77Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -0.71
References 1. KAI H, ICHIBA T, OHTSUKA T, TAKASE A, MASUKO M. (2000) Synthesis and Fungicidal Activities of (-Methoxybenzyl) isoxazoles, 25 (3): [10.1584/jpestics.25.240 ]