Flucythrinate

ID: ALA2289397

Cas Number: 70124-77-5

PubChem CID: 50980

Product Number: F117642, Order Now?

Max Phase: Preclinical

Molecular Formula: C26H23F2NO4

Molecular Weight: 451.47

Molecule Type: Small molecule

In stock!

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1

Standard InChI:  InChI=1S/C26H23F2NO4/c1-17(2)24(18-11-13-21(14-12-18)32-26(27)28)25(30)33-23(16-29)19-7-6-10-22(15-19)31-20-8-4-3-5-9-20/h3-15,17,23-24,26H,1-2H3

Standard InChI Key:  GBIHOLCMZGAKNG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    5.5319   -4.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5308   -5.7398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2455   -6.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9620   -5.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9592   -4.9089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2438   -4.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2413   -3.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9545   -3.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5256   -3.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5231   -2.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8124   -3.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6702   -3.6705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9521   -2.4351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3835   -3.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0991   -3.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0997   -4.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8145   -4.8989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5288   -4.4842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5236   -3.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8083   -3.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3838   -2.4328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3814   -1.6078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2355   -3.2378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9526   -3.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9526   -4.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6689   -4.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3817   -4.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3736   -3.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6567   -3.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2453   -6.9778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5308   -7.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5306   -8.2151    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.8164   -6.9774    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
  9 11  1  0
  8 12  1  0
  8 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 21 22  3  0
 14 21  1  0
 19 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  3 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Myzus persicae (1112 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.47Molecular Weight (Monoisotopic): 451.1595AlogP: 6.63#Rotatable Bonds: 9
Polar Surface Area: 68.55Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.64CX Basic pKa: CX LogP: 6.77CX LogD: 6.77
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -0.71

References

1. KAI H, ICHIBA T, OHTSUKA T, TAKASE A, MASUKO M.  (2000)  Synthesis and Fungicidal Activities of (-Methoxybenzyl) isoxazoles,  25  (3): [10.1584/jpestics.25.240]

Source