O,O'-Dimethyl alpha-(4-chloro-2-fluorophenoxyacetoxy)-alpha-(thien-2-yl)methylphosphonate

ID: ALA2289462

PubChem CID: 71524652

Max Phase: Preclinical

Molecular Formula: C15H15ClFO6PS

Molecular Weight: 408.77

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COP(=O)(OC)C(OC(=O)COc1ccc(Cl)cc1F)c1cccs1

Standard InChI:  InChI=1S/C15H15ClFO6PS/c1-20-24(19,21-2)15(13-4-3-7-25-13)23-14(18)9-22-12-6-5-10(16)8-11(12)17/h3-8,15H,9H2,1-2H3

Standard InChI Key:  JXMDGADBROAVJE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    7.9357   -5.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9357   -4.2609    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    7.9357   -3.4437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7529   -4.2609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1185   -4.2609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6448   -5.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7288   -6.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5272   -6.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9358   -5.7588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3880   -5.1523    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.2266   -5.4867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5175   -5.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8126   -5.4867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5175   -4.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8126   -3.8523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1035   -4.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3985   -3.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6894   -4.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6894   -5.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3985   -5.4867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1035   -5.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6448   -3.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1615   -3.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3996   -3.0351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9819   -5.4870    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  2  4  1  0
  2  5  2  0
  1  2  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  6 10  1  0
  1  6  1  0
 12 13  2  0
 12 14  1  0
 11 12  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 15 16  1  0
 14 15  1  0
  1 11  1  0
  3 22  1  0
  4 23  1  0
 17 24  1  0
 19 25  1  0
M  END

Associated Targets(non-human)

Eclipta prostrata (267 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Amaranthus retroflexus (1838 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Abutilon theophrasti (831 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Brassica rapa subsp. oleifera (1696 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.77Molecular Weight (Monoisotopic): 408.0000AlogP: 4.65#Rotatable Bonds: 8
Polar Surface Area: 71.06Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.80CX LogD: 3.80
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.47Np Likeness Score: -1.61

References

1. He HW, Peng H, Wang T, Wang C, Yuan JL, Chen T, He J, Tan X..  (2013)  α-(Substituted-phenoxyacetoxy)-α-heterocyclylmethylphosphonates: synthesis, herbicidal activity, inhibition on pyruvate dehydrogenase complex (PDHc), and application as postemergent herbicide against broadleaf weeds.,  61  (10): [PMID:23398199] [10.1021/jf305153h]

Source