4-chloro-3-ethyl-1-methyl-N-(4-(4-(trifluoromethyl)phenoxy)benzyl)-1H-pyrazole-5-carboxamide

ID: ALA2289584

PubChem CID: 15008416

Max Phase: Preclinical

Molecular Formula: C21H19ClF3N3O2

Molecular Weight: 437.85

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1nn(C)c(C(=O)NCc2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)c1Cl

Standard InChI:  InChI=1S/C21H19ClF3N3O2/c1-3-17-18(22)19(28(2)27-17)20(29)26-12-13-4-8-15(9-5-13)30-16-10-6-14(7-11-16)21(23,24)25/h4-11H,3,12H2,1-2H3,(H,26,29)

Standard InChI Key:  GOWCLDZKCUVLGU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   -0.8051  -18.3542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1702  -18.8644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5136  -18.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2987  -17.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5160  -17.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2138  -19.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9673  -16.9083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7858  -16.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8099  -16.9926    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2265  -18.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2374  -19.6334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9286  -18.3983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6417  -18.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3439  -18.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0531  -18.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7548  -18.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7443  -17.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0262  -17.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3275  -17.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4459  -17.1269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1596  -17.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1671  -18.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8799  -18.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5825  -18.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5678  -17.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8545  -17.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2967  -18.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3097  -19.5358    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.9977  -18.2988    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.0015  -19.1256    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  5  7  1  0
  7  8  1  0
  4  9  1  0
  3 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Associated Targets(non-human)

Nephotettix cincticeps (805 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.85Molecular Weight (Monoisotopic): 437.1118AlogP: 5.38#Rotatable Bonds: 6
Polar Surface Area: 56.15Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.15CX Basic pKa: 1.32CX LogP: 4.93CX LogD: 4.93
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.38

References

1. OKADA I, OKUI S, WADA M, TAKAHASHI Y.  (1996)  Synthesis and Insecticidal Activity of N-(4-Aryloxybenzyl)-pyrazolecarboxamide Derivatives,  21  (3): [10.1584/jpestics.21.305]

Source