4-chloro-3-ethyl-N-(4-(4-(ethylthio)phenoxy)benzyl)-1-methyl-1H-pyrazole-5-carboxamide

ID: ALA2289589

PubChem CID: 15008513

Max Phase: Preclinical

Molecular Formula: C22H24ClN3O2S

Molecular Weight: 429.97

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCSc1ccc(Oc2ccc(CNC(=O)c3c(Cl)c(CC)nn3C)cc2)cc1

Standard InChI:  InChI=1S/C22H24ClN3O2S/c1-4-19-20(23)21(26(3)25-19)22(27)24-14-15-6-8-16(9-7-15)28-17-10-12-18(13-11-17)29-5-2/h6-13H,4-5,14H2,1-3H3,(H,24,27)

Standard InChI Key:  RQXDHWZRZPWBHI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   30.9669   -9.5674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.6031  -10.0775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2850   -9.6301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0701   -8.8433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2556   -8.8047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5643  -10.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8072   -8.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9913   -8.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5813   -8.2058    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.9979  -10.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0088  -10.8466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7000   -9.6114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4132  -10.0105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1153   -9.5925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8245   -9.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5262   -9.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5157   -8.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7976   -8.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0989   -8.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2173   -8.3400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9310   -8.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9385   -9.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6513   -9.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3539   -9.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3392   -8.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6259   -8.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0681   -9.9319    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.0812  -10.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7953  -11.1461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  5  7  1  0
  7  8  1  0
  4  9  1  0
  3 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
M  END

Associated Targets(non-human)

Nephotettix cincticeps (805 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.97Molecular Weight (Monoisotopic): 429.1278AlogP: 5.47#Rotatable Bonds: 8
Polar Surface Area: 56.15Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.15CX Basic pKa: 1.32CX LogP: 4.94CX LogD: 4.94
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.48Np Likeness Score: -1.52

References

1. OKADA I, OKUI S, WADA M, TAKAHASHI Y.  (1996)  Synthesis and Insecticidal Activity of N-(4-Aryloxybenzyl)-pyrazolecarboxamide Derivatives,  21  (3): [10.1584/jpestics.21.305]

Source