4-chloro-N-(4-(4-(difluoromethoxy)phenoxy)benzyl)-3-ethyl-1-methyl-1H-pyrazole-5-carboxamide

ID: ALA2289593

PubChem CID: 15008445

Max Phase: Preclinical

Molecular Formula: C21H20ClF2N3O3

Molecular Weight: 435.86

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1nn(C)c(C(=O)NCc2ccc(Oc3ccc(OC(F)F)cc3)cc2)c1Cl

Standard InChI:  InChI=1S/C21H20ClF2N3O3/c1-3-17-18(22)19(27(2)26-17)20(28)25-12-13-4-6-14(7-5-13)29-15-8-10-16(11-9-15)30-21(23)24/h4-11,21H,3,12H2,1-2H3,(H,25,28)

Standard InChI Key:  RAYVZRAYKIJJAV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   30.5377   -5.6919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1739   -6.2021    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8557   -5.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6409   -4.9679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8263   -4.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1350   -7.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3779   -4.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5621   -4.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1521   -4.3303    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.5686   -6.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5796   -6.9711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2708   -5.7360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9839   -6.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6861   -5.7171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3953   -6.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0970   -5.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0865   -4.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3684   -4.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6696   -4.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7881   -4.4645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5017   -4.8627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5093   -5.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2221   -6.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9247   -5.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9100   -4.8379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1966   -4.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6388   -6.0564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6519   -6.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3661   -7.2707    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.9508   -7.2934    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  5  7  1  0
  7  8  1  0
  4  9  1  0
  3 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
M  END

Associated Targets(non-human)

Nephotettix cincticeps (805 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.86Molecular Weight (Monoisotopic): 435.1161AlogP: 4.96#Rotatable Bonds: 8
Polar Surface Area: 65.38Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.15CX Basic pKa: 1.32CX LogP: 4.83CX LogD: 4.83
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -1.50

References

1. OKADA I, OKUI S, WADA M, TAKAHASHI Y.  (1996)  Synthesis and Insecticidal Activity of N-(4-Aryloxybenzyl)-pyrazolecarboxamide Derivatives,  21  (3): [10.1584/jpestics.21.305]

Source