4-chloro-3-ethyl-N-(4-(4-methoxyphenoxy)benzyl)-1-methyl-1H-pyrazole-5-carboxamide

ID: ALA2289594

PubChem CID: 15008441

Max Phase: Preclinical

Molecular Formula: C21H22ClN3O3

Molecular Weight: 399.88

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1nn(C)c(C(=O)NCc2ccc(Oc3ccc(OC)cc3)cc2)c1Cl

Standard InChI:  InChI=1S/C21H22ClN3O3/c1-4-18-19(22)20(25(2)24-18)21(26)23-13-14-5-7-16(8-6-14)28-17-11-9-15(27-3)10-12-17/h5-12H,4,13H2,1-3H3,(H,23,26)

Standard InChI Key:  JLFVDQWAPQCZRV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    9.4599   -6.0386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0961   -6.5487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7780   -6.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5631   -5.3146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7486   -5.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0573   -7.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3002   -4.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4843   -4.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0743   -4.6770    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.4909   -6.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5018   -7.3178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1931   -6.0827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9062   -6.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6084   -6.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3175   -6.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0192   -6.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0087   -5.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2906   -4.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5919   -5.2509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7104   -4.8112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4240   -5.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4315   -6.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1443   -6.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8469   -6.0059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8322   -5.1846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1189   -4.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5611   -6.4031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5742   -7.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  5  7  1  0
  7  8  1  0
  4  9  1  0
  3 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
M  END

Associated Targets(non-human)

Nephotettix cincticeps (805 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.88Molecular Weight (Monoisotopic): 399.1350AlogP: 4.37#Rotatable Bonds: 7
Polar Surface Area: 65.38Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.15CX Basic pKa: 1.32CX LogP: 3.90CX LogD: 3.90
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.64Np Likeness Score: -1.12

References

1. OKADA I, OKUI S, WADA M, TAKAHASHI Y.  (1996)  Synthesis and Insecticidal Activity of N-(4-Aryloxybenzyl)-pyrazolecarboxamide Derivatives,  21  (3): [10.1584/jpestics.21.305]

Source