4-methyl-N-(4-methyl-2-nitrophenyl)-3-nitrobenzenesulfonamide

ID: ALA2289628

Cas Number: 87316-92-5

PubChem CID: 3323495

Max Phase: Preclinical

Molecular Formula: C14H13N3O6S

Molecular Weight: 351.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(NS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)c([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C14H13N3O6S/c1-9-3-6-12(14(7-9)17(20)21)15-24(22,23)11-5-4-10(2)13(8-11)16(18)19/h3-8,15H,1-2H3

Standard InChI Key:  DSZKFXMJRUVACP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   12.0985   -6.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2792   -6.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8573   -6.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2536   -7.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0762   -7.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4944   -6.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3115   -7.0063    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.7091   -7.7202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5262   -7.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9186   -8.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7349   -8.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1552   -7.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7532   -7.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9381   -7.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0957   -6.1454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0532   -6.7934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0402   -6.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8835   -5.5467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0664   -5.5311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3056   -4.8470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5361   -6.3185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7189   -6.3103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9518   -5.6150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9723   -7.7706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  7 15  2  0
  7 16  2  0
  3 17  1  0
 18 19  2  0
 18 20  1  0
  2 18  1  0
 21 22  2  0
 21 23  1  0
 14 21  1  0
 12 24  1  0
M  CHG  4  18   1  20  -1  21   1  23  -1
M  END

Associated Targets(non-human)

Plasmodiophora brassicae (194 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 351.34Molecular Weight (Monoisotopic): 351.0525AlogP: 2.92#Rotatable Bonds: 5
Polar Surface Area: 132.45Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.19CX Basic pKa: CX LogP: 3.37CX LogD: 2.59
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.65Np Likeness Score: -1.95

References

1. SHIMOTORI H, YANAGIDA H, ENOMOTO Y, IGARASHI K, YOSHINARI M, UMEMOTO M.  (1996)  Evaluation of Benzenesulfonanilide Derivatives for the Control of Crucifers Clubroot,  21  (1): [10.1584/jpestics.21.31]

Source