The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-bromophenyl)-3-chloro-1-(5-((4-chloro-2-(3-chlorobenzoyl)phenoxy)methyl)-1,3,4-oxadiazol-2-yl)azetidin-2-one ID: ALA2289731
PubChem CID: 76331188
Max Phase: Preclinical
Molecular Formula: C25H15BrCl3N3O4
Molecular Weight: 607.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cccc(Cl)c1)c1cc(Cl)ccc1OCc1nnc(N2C(=O)C(Cl)C2c2cccc(Br)c2)o1
Standard InChI: InChI=1S/C25H15BrCl3N3O4/c26-15-5-1-3-13(9-15)22-21(29)24(34)32(22)25-31-30-20(36-25)12-35-19-8-7-17(28)11-18(19)23(33)14-4-2-6-16(27)10-14/h1-11,21-22H,12H2
Standard InChI Key: WBQDMLSBXHIHGG-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
2.4177 -5.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4166 -6.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1308 -7.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8468 -6.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8439 -5.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1290 -5.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5655 -7.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5627 -7.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8439 -8.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8448 -9.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5600 -9.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2715 -9.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2753 -8.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2789 -6.6199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5647 -5.3607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5616 -4.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2739 -4.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0545 -4.3742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5372 -3.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0556 -3.0387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2749 -3.2924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3615 -3.7427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9186 -4.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9663 -3.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5202 -3.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8821 -5.1677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3438 -3.8234 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.0009 -2.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7293 -1.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7642 -1.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0677 -0.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3345 -1.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3031 -1.9279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9851 -9.5126 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.7022 -7.0219 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.4939 -0.7736 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 2 0
5 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 2 0
19 22 1 0
22 23 1 0
22 24 1 0
23 25 1 0
24 25 1 0
23 26 2 0
25 27 1 0
24 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
12 34 1 0
2 35 1 0
30 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.68Molecular Weight (Monoisotopic): 604.9312AlogP: 6.64#Rotatable Bonds: 7Polar Surface Area: 85.53Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.15CX Basic pKa: ┄CX LogP: 6.18CX LogD: 6.18Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.13Np Likeness Score: -1.06
References 1. Khanum SA, Shashikanth S, Sathyanarayana SG, Lokesh S, Deepak SA.. (2009) Synthesis and antifungal activity of 2-azetidinonyl-5-(2-benzoylphenoxy)methyl-1,3,4-oxadiazoles against seed-borne pathogens of Eleusine coracana (L.) Gaertn., 65 (7): [PMID:19319825 ] [10.1002/ps.1752 ]