4-(2-(2-(3,5-diethylphenoxy)ethoxy)benzylidene)-1-phenylpyrazolidine-3,5-dione

ID: ALA2295996

PubChem CID: 76316626

Max Phase: Preclinical

Molecular Formula: C28H28N2O4

Molecular Weight: 456.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1cc(CC)cc(OCCOc2ccccc2/C=C2/C(=O)NN(c3ccccc3)C2=O)c1

Standard InChI:  InChI=1S/C28H28N2O4/c1-3-20-16-21(4-2)18-24(17-20)33-14-15-34-26-13-9-8-10-22(26)19-25-27(31)29-30(28(25)32)23-11-6-5-7-12-23/h5-13,16-19H,3-4,14-15H2,1-2H3,(H,29,31)/b25-19-

Standard InChI Key:  ZLXQYZGZTPOCPM-PLRJNAJWSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   29.5427  -11.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3640  -11.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6184  -10.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9513  -10.2397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2884  -10.7259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.8436  -12.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0574  -12.1672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4000  -10.4703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5092  -10.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3400   -9.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5594   -9.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9514   -9.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1251  -10.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9055  -11.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5103  -12.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6923  -12.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3549  -13.7481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8388  -14.4149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6596  -14.3274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9892  -13.5777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8058  -13.4900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2921  -14.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1087  -14.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5950  -14.7259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4116  -14.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8915  -15.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7073  -15.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0425  -14.4618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5515  -13.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7374  -13.8867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8791  -13.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6954  -12.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1934  -15.8782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0100  -15.7908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  2  6  2  0
  1  7  2  0
  3  8  2  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  5  9  1  0
  6 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 29 31  1  0
 31 32  1  0
 27 33  1  0
 33 34  1  0
M  END

Associated Targets(Human)

DUSP26 Tbio Dual specificity protein phosphatase 26 (14 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.54Molecular Weight (Monoisotopic): 456.2049AlogP: 4.73#Rotatable Bonds: 9
Polar Surface Area: 67.87Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.27CX Basic pKa: CX LogP: 5.83CX LogD: 5.52
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -1.07

References

1. Park H, Kyung A, Lee H, Kang S, Yoon T, Ryu SE, Jeong DG.  (2013)  Virtual screening and biochemical evaluation of the inhibitors of dual-specificity phosphatase 26,  22  (8): [10.1007/s00044-012-0405-3]

Source