The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(2-(3,5-diethylphenoxy)ethoxy)benzylidene)-1-phenylpyrazolidine-3,5-dione ID: ALA2295996
PubChem CID: 76316626
Max Phase: Preclinical
Molecular Formula: C28H28N2O4
Molecular Weight: 456.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(CC)cc(OCCOc2ccccc2/C=C2/C(=O)NN(c3ccccc3)C2=O)c1
Standard InChI: InChI=1S/C28H28N2O4/c1-3-20-16-21(4-2)18-24(17-20)33-14-15-34-26-13-9-8-10-22(26)19-25-27(31)29-30(28(25)32)23-11-6-5-7-12-23/h5-13,16-19H,3-4,14-15H2,1-2H3,(H,29,31)/b25-19-
Standard InChI Key: ZLXQYZGZTPOCPM-PLRJNAJWSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
29.5427 -11.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3640 -11.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6184 -10.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9513 -10.2397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2884 -10.7259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8436 -12.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0574 -12.1672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4000 -10.4703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5092 -10.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3400 -9.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5594 -9.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9514 -9.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1251 -10.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9055 -11.0221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5103 -12.9187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6923 -12.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3549 -13.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8388 -14.4149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6596 -14.3274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9892 -13.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8058 -13.4900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2921 -14.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1087 -14.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5950 -14.7259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4116 -14.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8915 -15.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7073 -15.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0425 -14.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5515 -13.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7374 -13.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8791 -13.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6954 -12.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1934 -15.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0100 -15.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
2 6 2 0
1 7 2 0
3 8 2 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
5 9 1 0
6 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
29 31 1 0
31 32 1 0
27 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.54Molecular Weight (Monoisotopic): 456.2049AlogP: 4.73#Rotatable Bonds: 9Polar Surface Area: 67.87Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.27CX Basic pKa: ┄CX LogP: 5.83CX LogD: 5.52Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -1.07
References 1. Park H, Kyung A, Lee H, Kang S, Yoon T, Ryu SE, Jeong DG. (2013) Virtual screening and biochemical evaluation of the inhibitors of dual-specificity phosphatase 26, 22 (8): [10.1007/s00044-012-0405-3 ]