The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((5-(2-(2-cyanobenzyloxy)benzylidene)-3-ethyl-4-oxothiazolidin-2-ylidene)amino)benzoic acid ID: ALA2295997
PubChem CID: 1866600
Max Phase: Preclinical
Molecular Formula: C27H21N3O4S
Molecular Weight: 483.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN1C(=O)/C(=C/c2ccccc2OCc2ccccc2C#N)S/C1=N/c1ccc(C(=O)O)cc1
Standard InChI: InChI=1S/C27H21N3O4S/c1-2-30-25(31)24(35-27(30)29-22-13-11-18(12-14-22)26(32)33)15-19-7-5-6-10-23(19)34-17-21-9-4-3-8-20(21)16-28/h3-15H,2,17H2,1H3,(H,32,33)/b24-15-,29-27+
Standard InChI Key: XKBHJGJUASSFGU-KOAGXIKISA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-0.8832 -20.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0601 -20.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3514 -19.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0596 -18.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8796 -18.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2894 -19.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1727 -19.6331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5856 -18.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4013 -18.8339 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5714 -18.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8597 -17.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2523 -18.1684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7744 -16.8007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4489 -17.9984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1923 -17.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3222 -17.6941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9873 -18.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8987 -18.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5630 -19.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3147 -19.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3982 -18.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7329 -17.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8148 -17.0268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5640 -16.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6458 -15.8698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3964 -15.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4786 -14.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8108 -14.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0588 -14.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9803 -15.3968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0626 -16.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7250 -16.4957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1160 -19.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5225 -18.9256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5185 -20.3492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
11 13 2 0
12 14 1 0
14 15 1 0
10 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
31 32 3 0
26 31 1 0
33 34 1 0
33 35 2 0
6 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.55Molecular Weight (Monoisotopic): 483.1253AlogP: 5.46#Rotatable Bonds: 7Polar Surface Area: 102.99Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.08CX Basic pKa: 2.30CX LogP: 5.44CX LogD: 2.45Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.45Np Likeness Score: -1.64
References 1. Park H, Kyung A, Lee H, Kang S, Yoon T, Ryu SE, Jeong DG. (2013) Virtual screening and biochemical evaluation of the inhibitors of dual-specificity phosphatase 26, 22 (8): [10.1007/s00044-012-0405-3 ]