2-[2-{4-2'-(Tetrazol-4-yl)-biphenyl}-piperazin-1-yl)ethoxy]ethanol

ID: ALA2296619

PubChem CID: 76324041

Max Phase: Preclinical

Molecular Formula: C22H28N6O2

Molecular Weight: 408.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OCCOCCN1CCN(Cc2ccc(-c3ccccc3-c3nnn[nH]3)cc2)CC1

Standard InChI:  InChI=1S/C22H28N6O2/c29-14-16-30-15-13-27-9-11-28(12-10-27)17-18-5-7-19(8-6-18)20-3-1-2-4-21(20)22-23-25-26-24-22/h1-8,29H,9-17H2,(H,23,24,25,26)

Standard InChI Key:  BFZFORGACSCNKM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   22.3351   -5.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3339   -6.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0487   -7.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7650   -6.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7622   -5.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0469   -5.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0415   -4.7524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7563   -4.3384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7542   -3.5141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0381   -3.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3225   -3.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3281   -4.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4778   -5.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2325   -5.9023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7829   -5.2866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3660   -4.5734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5594   -4.7507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0344   -2.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7472   -1.8621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4623   -2.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1729   -1.8638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1733   -1.0383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4570   -0.6268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7403   -1.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8874   -0.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6022   -1.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3163   -0.6241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0310   -1.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7451   -0.6229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4600   -1.0347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  6  7  1  0
 14 15  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 13  2  0
  5 13  1  0
 10 18  1  0
 18 19  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Associated Targets(Human)

ACE Tclin Angiotensin-converting enzyme (1423 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.51Molecular Weight (Monoisotopic): 408.2274AlogP: 1.66#Rotatable Bonds: 9
Polar Surface Area: 90.40Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.23CX Basic pKa: 7.82CX LogP: -0.05CX LogD: 0.10
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -1.26

References

1. Meti GY, Kamble RR, Biradar DB, Margankop SB.  (2013)  Synthesis of biphenyl derivatives as ACE and -amylase inhibitors,  22  (12): [10.1007/s00044-013-0574-8]

Source