The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[2-{4-2'-(Tetrazol-4-yl)-biphenyl}-piperazin-1-yl)ethoxy]ethanol ID: ALA2296619
PubChem CID: 76324041
Max Phase: Preclinical
Molecular Formula: C22H28N6O2
Molecular Weight: 408.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: OCCOCCN1CCN(Cc2ccc(-c3ccccc3-c3nnn[nH]3)cc2)CC1
Standard InChI: InChI=1S/C22H28N6O2/c29-14-16-30-15-13-27-9-11-28(12-10-27)17-18-5-7-19(8-6-18)20-3-1-2-4-21(20)22-23-25-26-24-22/h1-8,29H,9-17H2,(H,23,24,25,26)
Standard InChI Key: BFZFORGACSCNKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
22.3351 -5.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3339 -6.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0487 -7.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7650 -6.8141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7622 -5.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0469 -5.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0415 -4.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7563 -4.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7542 -3.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0381 -3.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3225 -3.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3281 -4.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4778 -5.5683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2325 -5.9023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7829 -5.2866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3660 -4.5734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5594 -4.7507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0344 -2.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7472 -1.8621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4623 -2.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1729 -1.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1733 -1.0383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4570 -0.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7403 -1.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8874 -0.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6022 -1.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3163 -0.6241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0310 -1.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7451 -0.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4600 -1.0347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
6 7 1 0
14 15 1 0
13 14 1 0
15 16 2 0
16 17 1 0
17 13 2 0
5 13 1 0
10 18 1 0
18 19 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.51Molecular Weight (Monoisotopic): 408.2274AlogP: 1.66#Rotatable Bonds: 9Polar Surface Area: 90.40Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.23CX Basic pKa: 7.82CX LogP: -0.05CX LogD: 0.10Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -1.26
References 1. Meti GY, Kamble RR, Biradar DB, Margankop SB. (2013) Synthesis of biphenyl derivatives as ACE and -amylase inhibitors, 22 (12): [10.1007/s00044-013-0574-8 ]