The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{3-[4-(2,4-fluoro-benzyl)-piperizin-1-yl]-propoxy}-7-methoxy-3-phenyl-2H-chromen-2-one ID: ALA2296906
PubChem CID: 76316716
Max Phase: Preclinical
Molecular Formula: C30H30F2N2O4
Molecular Weight: 520.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(OCCCN3CCN(Cc4ccc(F)cc4F)CC3)c(-c3ccccc3)c(=O)oc2c1
Standard InChI: InChI=1S/C30H30F2N2O4/c1-36-24-10-11-25-27(19-24)38-30(35)28(21-6-3-2-4-7-21)29(25)37-17-5-12-33-13-15-34(16-14-33)20-22-8-9-23(31)18-26(22)32/h2-4,6-11,18-19H,5,12-17,20H2,1H3
Standard InChI Key: KNSPVQILFASOKR-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
20.6966 -7.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6955 -8.7108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4035 -9.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4017 -7.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9888 -7.4828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9886 -6.6656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1104 -7.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1138 -8.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8261 -9.1202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5397 -8.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5363 -7.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8194 -7.4698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2427 -7.4710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8284 -9.9374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1218 -10.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4129 -9.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7063 -10.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9975 -9.9451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9940 -9.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2892 -8.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5802 -9.1258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5805 -9.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2897 -10.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2461 -9.1129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2469 -9.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9549 -10.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6625 -9.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6576 -9.1058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9491 -8.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8729 -8.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1648 -9.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4584 -8.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7565 -9.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7496 -9.9427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4617 -10.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1664 -9.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4571 -7.9002 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.0406 -10.3490 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 8 2 0
7 4 2 0
4 1 1 0
1 5 1 0
5 6 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
10 24 1 0
21 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
32 37 1 0
34 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.58Molecular Weight (Monoisotopic): 520.2174AlogP: 5.33#Rotatable Bonds: 9Polar Surface Area: 55.15Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.80CX LogP: 4.59CX LogD: 4.04Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: -0.80
References 1. Mandala D, Valeru A, Pochampalli J, Vankadari SR, Tigulla P, Gatla R, Thampu R. (2013) Synthesis, antimicrobial activity, and molecular modeling of novel 4-(3-(4-benzylpiperazin-1-yl)propoxy)-7-methoxy-3-substituted phenyl-2H-chromen-2-one, 22 (11): [10.1007/s00044-013-0543-2 ]