The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{3-[4-(4-propoxy-benzyl)-piperizin-1-yl]-propoxy}-7-methoxy-3-phenyl-2H-chromen-2-one ID: ALA2296908
PubChem CID: 76320431
Max Phase: Preclinical
Molecular Formula: C33H38N2O5
Molecular Weight: 542.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCOc1ccc(CN2CCN(CCCOc3c(-c4ccccc4)c(=O)oc4cc(OC)ccc34)CC2)cc1
Standard InChI: InChI=1S/C33H38N2O5/c1-3-21-38-27-12-10-25(11-13-27)24-35-19-17-34(18-20-35)16-7-22-39-32-29-15-14-28(37-2)23-30(29)40-33(36)31(32)26-8-5-4-6-9-26/h4-6,8-15,23H,3,7,16-22,24H2,1-2H3
Standard InChI Key: LWSNVLCQDVTLTC-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
6.4082 -13.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4070 -14.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1151 -14.8401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1133 -13.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7004 -13.2031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7002 -12.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8219 -13.6080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8253 -14.4332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5377 -14.8406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2512 -14.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2478 -13.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5309 -13.1902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9543 -13.1913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5399 -15.6577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8333 -16.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1245 -15.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4179 -16.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7091 -15.6654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7055 -14.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0007 -14.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2917 -14.8461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2920 -15.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0013 -16.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9576 -14.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9585 -15.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6665 -16.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3740 -15.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3692 -14.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6606 -14.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5845 -14.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8763 -14.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1699 -14.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4681 -14.8449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4611 -15.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1732 -16.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8780 -15.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7521 -16.0693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7495 -16.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0404 -17.2928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0378 -18.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 8 2 0
7 4 2 0
4 1 1 0
1 5 1 0
5 6 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
10 24 1 0
21 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.68Molecular Weight (Monoisotopic): 542.2781AlogP: 5.84#Rotatable Bonds: 12Polar Surface Area: 64.38Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.06CX LogP: 5.02CX LogD: 4.28Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.16Np Likeness Score: -0.49
References 1. Mandala D, Valeru A, Pochampalli J, Vankadari SR, Tigulla P, Gatla R, Thampu R. (2013) Synthesis, antimicrobial activity, and molecular modeling of novel 4-(3-(4-benzylpiperazin-1-yl)propoxy)-7-methoxy-3-substituted phenyl-2H-chromen-2-one, 22 (11): [10.1007/s00044-013-0543-2 ]