The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(4-((pyridin-3-yl)methyl)piperzine-1-yl)propoxy)-7-methoxy-3-phenyl-2H-chromen-2-one ID: ALA2296910
PubChem CID: 76334878
Max Phase: Preclinical
Molecular Formula: C29H31N3O4
Molecular Weight: 485.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(OCCCN3CCN(Cc4cccnc4)CC3)c(-c3ccccc3)c(=O)oc2c1
Standard InChI: InChI=1S/C29H31N3O4/c1-34-24-10-11-25-26(19-24)36-29(33)27(23-8-3-2-4-9-23)28(25)35-18-6-13-31-14-16-32(17-15-31)21-22-7-5-12-30-20-22/h2-5,7-12,19-20H,6,13-18,21H2,1H3
Standard InChI Key: RSGAPKRJXCNGEP-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
6.7157 -19.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7146 -20.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4289 -20.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4271 -18.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0015 -18.9105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0013 -18.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1421 -19.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1455 -20.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8643 -20.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5843 -20.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5809 -19.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8575 -18.8973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2937 -18.8986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8665 -21.3871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1536 -21.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4384 -21.3910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7255 -21.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0103 -21.3949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0066 -20.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2956 -20.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5802 -20.5681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5804 -21.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2961 -21.8085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2970 -20.5552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2979 -21.3809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0123 -21.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7262 -21.3769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7213 -20.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0064 -20.1415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8666 -20.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1520 -20.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4393 -20.1562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7311 -20.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7242 -21.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4426 -21.8053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1537 -21.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 8 2 0
7 4 2 0
4 1 1 0
1 5 1 0
5 6 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
10 24 1 0
21 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.2315AlogP: 4.45#Rotatable Bonds: 9Polar Surface Area: 68.04Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.90CX LogP: 3.09CX LogD: 2.46Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -0.61
References 1. Mandala D, Valeru A, Pochampalli J, Vankadari SR, Tigulla P, Gatla R, Thampu R. (2013) Synthesis, antimicrobial activity, and molecular modeling of novel 4-(3-(4-benzylpiperazin-1-yl)propoxy)-7-methoxy-3-substituted phenyl-2H-chromen-2-one, 22 (11): [10.1007/s00044-013-0543-2 ]