The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-({[(6,7-Dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl)methyl](ethyl)amino}methyl)imidazo[1,2-a]pyridin-1-ium ID: ALA2297165
PubChem CID: 136240234
Max Phase: Preclinical
Molecular Formula: C21H23N5O3
Molecular Weight: 393.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(Cc1cn2ccccc2n1)Cc1nc2cc(OC)c(OC)cc2c(=O)[nH]1
Standard InChI: InChI=1S/C21H23N5O3/c1-4-25(11-14-12-26-8-6-5-7-20(26)22-14)13-19-23-16-10-18(29-3)17(28-2)9-15(16)21(27)24-19/h5-10,12H,4,11,13H2,1-3H3,(H,23,24,27)
Standard InChI Key: SPZPTJAXGLPDKQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
2.2716 -24.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0966 -24.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5083 -23.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8599 -23.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2680 -22.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0949 -22.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5044 -22.2336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0880 -21.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2579 -21.5260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8522 -22.2429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0254 -22.2491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4970 -20.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3238 -20.7958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7329 -20.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7416 -21.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5597 -20.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0515 -20.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0433 -19.3968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8312 -19.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8332 -20.4722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5474 -20.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2600 -20.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2540 -19.6384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5393 -19.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5684 -21.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8583 -25.0919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0315 -25.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5094 -25.0932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0955 -25.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 5 1 0
10 11 2 0
8 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
14 16 1 0
16 17 2 0
17 20 1 0
19 18 2 0
18 16 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
15 25 1 0
1 26 1 0
26 27 1 0
2 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.45Molecular Weight (Monoisotopic): 393.1801AlogP: 2.61#Rotatable Bonds: 7Polar Surface Area: 84.75Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.67CX Basic pKa: 5.85CX LogP: 1.30CX LogD: 1.29Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.52Np Likeness Score: -1.94
References 1. Agrawal R, Jain P, Dikshit SN, Bahare RS, Ganguly S. (2013) Ligand-based pharmacophore detection, screening of potential pharmacophore and docking studies, to get effective glycogen synthase kinase inhibitors, 22 (11): [10.1007/s00044-013-0547-y ]