kuwanonU

ID: ALA2297276

PubChem CID: 14539882

Max Phase: Preclinical

Molecular Formula: C26H30O6

Molecular Weight: 438.52

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c(C2CC(=O)c3c(O)cc(O)cc3O2)cc1C/C=C(\C)CCC=C(C)C

Standard InChI:  InChI=1S/C26H30O6/c1-15(2)6-5-7-16(3)8-9-17-10-19(20(28)13-23(17)31-4)24-14-22(30)26-21(29)11-18(27)12-25(26)32-24/h6,8,10-13,24,27-29H,5,7,9,14H2,1-4H3/b16-8+

Standard InChI Key:  CZVSHXUUSIQWSO-LZYBPNLTSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   22.0627  -14.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0616  -15.8055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7696  -16.2144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7679  -14.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4765  -14.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4799  -15.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1922  -16.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9058  -15.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9024  -14.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1855  -14.5645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1945  -17.0321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3549  -14.5775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6078  -14.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3171  -14.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0230  -14.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0209  -13.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3070  -13.3398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6040  -13.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7268  -13.3343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7682  -17.0316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8939  -13.3477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7318  -14.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7339  -15.7880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0273  -16.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0294  -17.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3185  -15.7917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3228  -17.4261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7232  -12.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3249  -18.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6183  -18.6537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6204  -19.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9095  -18.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  2  0
  1 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  9 13  1  0
 16 19  1  0
  3 20  1  0
 18 21  1  0
 15 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 24 26  1  0
 25 27  1  0
 19 28  1  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2297276

    KUWANONU

Associated Targets(Human)

BCHE Tclin Butyrylcholinesterase (7174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ACHE Tclin Acetylcholinesterase (18204 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.52Molecular Weight (Monoisotopic): 438.2042AlogP: 5.75#Rotatable Bonds: 7
Polar Surface Area: 96.22Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.84CX Basic pKa: CX LogP: 6.07CX LogD: 5.93
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: 2.33

References

1. Anand P, Singh B.  (2013)  Flavonoids as lead compounds modulating the enzyme targets in Alzheimers disease,  22  (7): [10.1007/s00044-012-0353-y]

Source