The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5'-geranyl-5,7,2',4'-tetrahydroxyflavone ID: ALA2297277
Cas Number: 1221762-70-4
PubChem CID: 46211767
Max Phase: Preclinical
Molecular Formula: C25H26O6
Molecular Weight: 422.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=CCC/C(C)=C/Cc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)c(O)cc1O
Standard InChI: InChI=1S/C25H26O6/c1-14(2)5-4-6-15(3)7-8-16-9-18(20(28)12-19(16)27)23-13-22(30)25-21(29)10-17(26)11-24(25)31-23/h5,7,9-13,26-29H,4,6,8H2,1-3H3/b15-7+
Standard InChI Key: CGAAHNXTXSLXAJ-VIZOYTHASA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
14.4975 -15.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4964 -15.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2044 -16.3878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2026 -14.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9113 -15.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9147 -15.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6270 -16.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3406 -15.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3372 -15.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6203 -14.7379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6293 -17.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7897 -14.7508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0426 -14.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7519 -15.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4578 -14.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4557 -13.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7418 -13.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0387 -13.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1616 -13.5076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2030 -17.2050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3287 -13.5211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1666 -15.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1687 -15.9613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4621 -16.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4642 -17.1890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7533 -15.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7576 -17.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7597 -18.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0531 -18.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0552 -19.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3443 -18.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
7 11 2 0
1 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 13 1 0
16 19 1 0
3 20 1 0
18 21 1 0
15 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
24 26 1 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.48Molecular Weight (Monoisotopic): 422.1729AlogP: 5.52#Rotatable Bonds: 6Polar Surface Area: 111.13Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.56CX Basic pKa: ┄CX LogP: 5.79CX LogD: 4.79Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.39Np Likeness Score: 2.13
References 1. Anand P, Singh B. (2013) Flavonoids as lead compounds modulating the enzyme targets in Alzheimers disease, 22 (7): [10.1007/s00044-012-0353-y ]