The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(3,7-dimethylocta-2,6-dienyl)-2-hydroxy-4-methoxyphenyl)-5,7-dihydroxy-4H-chromen-4-one ID: ALA2297278
PubChem CID: 53242257
Max Phase: Preclinical
Molecular Formula: C26H28O6
Molecular Weight: 436.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1C/C=C(\C)CCC=C(C)C
Standard InChI: InChI=1S/C26H28O6/c1-15(2)6-5-7-16(3)8-9-17-10-19(20(28)13-23(17)31-4)24-14-22(30)26-21(29)11-18(27)12-25(26)32-24/h6,8,10-14,27-29H,5,7,9H2,1-4H3/b16-8+
Standard InChI Key: QGNFPYTXEYXYEC-LZYBPNLTSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
7.3120 -16.4717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3109 -17.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0189 -17.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0171 -16.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7258 -16.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7292 -17.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4415 -17.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1551 -17.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1517 -16.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4348 -16.0503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4437 -18.5179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -16.0633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8571 -16.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5664 -16.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2723 -16.0499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2702 -15.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5563 -14.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8532 -15.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9761 -14.8201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0175 -18.5174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1432 -14.8335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9811 -16.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9832 -17.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2766 -17.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2787 -18.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5678 -17.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5721 -18.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8633 -18.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1567 -18.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3606 -19.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1489 -19.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9725 -14.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
7 11 2 0
1 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 13 1 0
16 19 1 0
3 20 1 0
18 21 1 0
15 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
24 26 1 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
29 31 1 0
19 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.50Molecular Weight (Monoisotopic): 436.1886AlogP: 5.82#Rotatable Bonds: 7Polar Surface Area: 100.13Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.57CX Basic pKa: ┄CX LogP: 5.94CX LogD: 4.95Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: 2.01
References 1. Anand P, Singh B. (2013) Flavonoids as lead compounds modulating the enzyme targets in Alzheimers disease, 22 (7): [10.1007/s00044-012-0353-y ]