The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{4-[3-(4-Fluoro-phenyl)-2-(4-fluoro-phenylimino)-4-oxothiazolidin-5-ylidenemethyl]-phenoxy}-acetic acid ID: ALA2297509
PubChem CID: 76320473
Max Phase: Preclinical
Molecular Formula: C24H16F2N2O4S
Molecular Weight: 466.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)COc1ccc(/C=C2/S/C(=N\c3ccc(F)cc3)N(c3ccc(F)cc3)C2=O)cc1
Standard InChI: InChI=1S/C24H16F2N2O4S/c25-16-3-7-18(8-4-16)27-24-28(19-9-5-17(26)6-10-19)23(31)21(33-24)13-15-1-11-20(12-2-15)32-14-22(29)30/h1-13H,14H2,(H,29,30)/b21-13+,27-24-
Standard InChI Key: OHSNKRRKYBJALD-CIFGJUBISA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
26.0538 -9.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0526 -10.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7607 -11.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4703 -10.6253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4675 -9.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7589 -9.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1787 -11.0328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8858 -10.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6292 -10.9532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1750 -10.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7653 -9.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9663 -9.8092 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.9879 -10.4292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0964 -8.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9090 -8.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3907 -9.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2026 -9.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5345 -8.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0484 -7.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2383 -8.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7997 -11.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1914 -12.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3618 -13.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1401 -13.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7480 -12.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5744 -11.9979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3469 -8.5479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8292 -9.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6417 -9.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1240 -9.7794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.9718 -8.3722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3460 -9.3978 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.3121 -14.1456 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
10 13 2 0
11 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
9 21 1 0
18 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
1 32 1 0
24 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.47Molecular Weight (Monoisotopic): 466.0799AlogP: 5.24#Rotatable Bonds: 6Polar Surface Area: 79.20Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.41CX Basic pKa: ┄CX LogP: 5.40CX LogD: 2.00Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -1.54
References 1. Zhao D, Liu H, Zheng L, He G, Qu D, Han S. (2013) Synthesis of novel 4-thiazolidione derivatives as antibacterial agents against drug-resistant Staphylococcus epidermidis, 22 (8): [10.1007/s00044-012-0363-9 ]