The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
{4-[3-(4-Chloro-phenyl)-2-(4-chloro-phenylimino)-4-oxothiazolidin-5-ylidenemethyl]-2-methoxy-phenoxy}-acetic acid ID: ALA2297513
PubChem CID: 76327678
Max Phase: Preclinical
Molecular Formula: C25H18Cl2N2O5S
Molecular Weight: 529.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C2/S/C(=N\c3ccc(Cl)cc3)N(c3ccc(Cl)cc3)C2=O)ccc1OCC(=O)O
Standard InChI: InChI=1S/C25H18Cl2N2O5S/c1-33-21-12-15(2-11-20(21)34-14-23(30)31)13-22-24(32)29(19-9-5-17(27)6-10-19)25(35-22)28-18-7-3-16(26)4-8-18/h2-13H,14H2,1H3,(H,30,31)/b22-13+,28-25-
Standard InChI Key: HUFBBLXEHLZQSQ-ASCZMWPCSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
13.9734 -24.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9722 -25.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6803 -25.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3899 -25.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3871 -24.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6785 -24.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0983 -25.9734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8054 -25.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5488 -25.8937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0946 -25.2856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6849 -24.5785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8859 -24.7497 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.9075 -25.3697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0160 -23.8314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8286 -23.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3103 -24.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1222 -24.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4541 -23.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9680 -22.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1579 -23.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7193 -26.6893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1110 -27.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2815 -28.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0597 -28.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6676 -27.7349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4940 -26.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2665 -23.4885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7488 -24.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5613 -24.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0436 -24.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8914 -23.3128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2656 -24.3384 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.2966 -22.1658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1088 -22.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2317 -29.0861 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
10 13 2 0
11 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
9 21 1 0
18 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
1 32 1 0
19 33 1 0
33 34 1 0
24 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.40Molecular Weight (Monoisotopic): 528.0313AlogP: 6.27#Rotatable Bonds: 7Polar Surface Area: 88.43Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.27CX Basic pKa: ┄CX LogP: 6.16CX LogD: 2.73Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.34
References 1. Zhao D, Liu H, Zheng L, He G, Qu D, Han S. (2013) Synthesis of novel 4-thiazolidione derivatives as antibacterial agents against drug-resistant Staphylococcus epidermidis, 22 (8): [10.1007/s00044-012-0363-9 ]