The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{4-[3-(4-Chloro-phenyl)-2-(4-chloro-phenylimino)-4-oxo-thiazolidin-5-ylidenemethyl]-phenoxymethyl}-benzoic acid ID: ALA2297520
PubChem CID: 76324132
Max Phase: Preclinical
Molecular Formula: C30H20Cl2N2O4S
Molecular Weight: 575.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(COc2ccc(/C=C3/S/C(=N\c4ccc(Cl)cc4)N(c4ccc(Cl)cc4)C3=O)cc2)cc1
Standard InChI: InChI=1S/C30H20Cl2N2O4S/c31-22-7-11-24(12-8-22)33-30-34(25-13-9-23(32)10-14-25)28(35)27(39-30)17-19-3-15-26(16-4-19)38-18-20-1-5-21(6-2-20)29(36)37/h1-17H,18H2,(H,36,37)/b27-17+,33-30-
Standard InChI Key: YIHABSCNQJFXOF-CVKDESKCSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
1.4514 -9.8723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4502 -10.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1583 -11.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8679 -10.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8651 -9.8687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1565 -9.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5763 -11.0988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2833 -10.6891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0268 -11.0192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5726 -10.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1629 -9.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3639 -9.8752 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.3855 -10.4952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4940 -8.9568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3066 -8.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7883 -9.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6002 -9.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9321 -8.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4460 -8.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6359 -8.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1973 -11.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5890 -12.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7594 -13.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5377 -13.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1456 -12.8603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9720 -12.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7436 -9.4639 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.7445 -8.6139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2268 -9.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0393 -9.1858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5169 -9.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3286 -9.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6596 -9.0113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1726 -8.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3626 -8.4405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4752 -8.9216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9584 -9.5806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8044 -8.1736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7097 -14.2116 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
10 13 2 0
11 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
9 21 1 0
1 27 1 0
18 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
36 37 1 0
36 38 2 0
33 36 1 0
24 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 575.47Molecular Weight (Monoisotopic): 574.0521AlogP: 8.08#Rotatable Bonds: 7Polar Surface Area: 79.20Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.06CX Basic pKa: ┄CX LogP: 8.23CX LogD: 5.10Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -1.26
References 1. Zhao D, Liu H, Zheng L, He G, Qu D, Han S. (2013) Synthesis of novel 4-thiazolidione derivatives as antibacterial agents against drug-resistant Staphylococcus epidermidis, 22 (8): [10.1007/s00044-012-0363-9 ]