3-(3'-chloro-4'-fluorobiphenyl-4-yl)-2-(1-((S)-2-mercapto-3-methylbutanamido)cyclopentanecarboxamido)propanoic acid

ID: ALA2297551

PubChem CID: 76331357

Max Phase: Preclinical

Molecular Formula: C26H30ClFN2O4S

Molecular Weight: 521.05

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(C)[C@H](S)C(=O)NC1(C(=O)NC(Cc2ccc(-c3ccc(F)c(Cl)c3)cc2)C(=O)O)CCCC1

Standard InChI:  InChI=1S/C26H30ClFN2O4S/c1-15(2)22(35)23(31)30-26(11-3-4-12-26)25(34)29-21(24(32)33)13-16-5-7-17(8-6-16)18-9-10-20(28)19(27)14-18/h5-10,14-15,21-22,35H,3-4,11-13H2,1-2H3,(H,29,34)(H,30,31)(H,32,33)/t21?,22-/m0/s1

Standard InChI Key:  IRHYHTDCCYUMHU-KEKNWZKVSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    6.3711  -15.6586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7878  -16.3753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2001  -15.6561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3794  -17.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2044  -17.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4612  -16.8620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1269  -16.8620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0251  -15.6536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7855  -14.9429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4354  -14.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2604  -14.9354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0208  -14.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4311  -13.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6767  -15.6487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6723  -14.2198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5461  -15.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1315  -14.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1358  -16.3768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5418  -14.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3065  -14.9504    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.1271  -13.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3668  -14.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2569  -13.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6671  -12.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0166  -12.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4231  -12.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2522  -12.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6581  -11.3665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4842  -11.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8936  -10.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4779   -9.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6487   -9.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2431  -10.6574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8864   -9.2184    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.7186  -10.6458    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  2  7  1  0
  7  4  1  0
  3  8  1  0
  3  9  2  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 11 14  1  0
 11 15  2  0
  1 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  1
 17 20  1  0
 19 21  1  0
 19 22  1  0
 13 23  2  0
 23 24  1  0
 24 27  2  0
 26 25  2  0
 25 13  1  0
 26 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 27 28  1  0
 31 34  1  0
 30 35  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2297551

   3-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[[1-[[(2S)-3-methyl-2-sulfanylbutanoyl]amino]cyclopentanecarbonyl]amino]propanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 521.05

Molecular Weight (Monoisotopic): 520.1599

AlogP: 4.64

#Rotatable Bonds: 9

Polar Surface Area: 95.50

Molecular Species: ACID

HBA: 4

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 3.73

CX Basic pKa: ┄

CX LogP: 5.45

CX LogD: 2.15

Aromatic Rings: 2

Heavy Atoms: 35

QED Weighted: 0.36

Np Likeness Score: -0.62

References

1. Tanneeru K, Sahu I, Guruprasad L.  (2013)  Ligand-based drug design for human endothelin converting enzyme-1 inhibitors,  22  (9): [10.1007/s00044-012-0433-z]

2. Umekawa, K K and 5 more authors.  2000-09  Pharmacological characterization of a novel sulfonylureid-pyrazole derivative, SM-19712, a potent nonpeptidic inhibitor of endothelin converting enzyme.  [PMID:11043447]

3. Inguimbert, Nicolas N and 6 more authors.  2002-03-28  Toward an optimal joint recognition of the S1' subsites of endothelin converting enzyme-1 (ECE-1), angiotensin converting enzyme (ACE), and neutral endopeptidase (NEP).  [PMID:11906289]

4. Berger, Yann Y and 6 more authors.  2005-01-27  Endothelin-converting enzyme-1 inhibition and growth of human glioblastoma cells.  [PMID:15658862]

5. Seed, Alison A and 8 more authors.  2012-10-15  The dual endothelin converting enzyme/neutral endopeptidase inhibitor SLV-306 (daglutril), inhibits systemic conversion of big endothelin-1 in humans.  [PMID:22480515]

6. McKinnell, R Murray RM and 13 more authors.  2019-01-10  Discovery of TD-0212, an Orally Active Dual Pharmacology AT1 Antagonist and Neprilysin Inhibitor (ARNI).  [PMID:30655952]

Source

Source(1):

• Scientific Literature