3-(biphenyl-4-yl)-2-(1-((2R,3R)-2-mercapto-3-methylpentanamido)cyclopentanecarboxamido)propanoic acid

ID: ALA2297558

PubChem CID: 76313237

Max Phase: Preclinical

Molecular Formula: C27H34N2O4S

Molecular Weight: 482.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@@H](C)[C@@H](S)C(=O)NC1(C(=O)NC(Cc2ccc(-c3ccccc3)cc2)C(=O)O)CCCC1

Standard InChI:  InChI=1S/C27H34N2O4S/c1-3-18(2)23(34)24(30)29-27(15-7-8-16-27)26(33)28-22(25(31)32)17-19-11-13-21(14-12-19)20-9-5-4-6-10-20/h4-6,9-14,18,22-23,34H,3,7-8,15-17H2,1-2H3,(H,28,33)(H,29,30)(H,31,32)/t18-,22?,23-/m1/s1

Standard InChI Key:  OGXZPPQKOPSYNJ-GHVLARLOSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    2.7652  -19.3567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1780  -20.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5864  -19.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7735  -21.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5907  -21.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8450  -20.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5233  -20.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4036  -19.3517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1756  -18.6477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8100  -18.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6272  -18.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3993  -17.9363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8057  -17.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0395  -19.3469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0352  -17.9315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9481  -19.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5338  -18.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5416  -20.0681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6237  -17.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0300  -16.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6192  -15.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7978  -15.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3952  -16.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0220  -15.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8403  -15.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2457  -14.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8340  -13.6869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0126  -13.6931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6108  -14.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9375  -17.9426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7167  -18.6588    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7547  -17.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5240  -17.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9276  -16.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  2  7  1  0
  7  4  1  0
  3  8  1  0
  3  9  2  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 11 14  1  0
 11 15  2  0
  1 16  1  0
 16 17  1  0
 16 18  2  0
 13 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 13  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 21 24  1  0
 17 30  1  0
 17 31  1  6
 30 32  1  1
 30 33  1  0
 33 34  1  0
M  END

Associated Targets(Human)

ECE1 Tchem Endothelin-converting enzyme 1 (674 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 482.65Molecular Weight (Monoisotopic): 482.2239AlogP: 4.24#Rotatable Bonds: 10
Polar Surface Area: 95.50Molecular Species: ACIDHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.90CX Basic pKa: CX LogP: 5.15CX LogD: 1.93
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -0.21

References

1. Tanneeru K, Sahu I, Guruprasad L.  (2013)  Ligand-based drug design for human endothelin converting enzyme-1 inhibitors,  22  (9): [10.1007/s00044-012-0433-z]
2. Umekawa, K K and 5 more authors.  2000-09  Pharmacological characterization of a novel sulfonylureid-pyrazole derivative, SM-19712, a potent nonpeptidic inhibitor of endothelin converting enzyme.  [PMID:11043447]
3. Inguimbert, Nicolas N and 6 more authors.  2002-03-28  Toward an optimal joint recognition of the S1' subsites of endothelin converting enzyme-1 (ECE-1), angiotensin converting enzyme (ACE), and neutral endopeptidase (NEP).  [PMID:11906289]
4. Berger, Yann Y and 6 more authors.  2005-01-27  Endothelin-converting enzyme-1 inhibition and growth of human glioblastoma cells.  [PMID:15658862]
5. Seed, Alison A and 8 more authors.  2012-10-15  The dual endothelin converting enzyme/neutral endopeptidase inhibitor SLV-306 (daglutril), inhibits systemic conversion of big endothelin-1 in humans.  [PMID:22480515]
6. McKinnell, R Murray RM and 13 more authors.  2019-01-10  Discovery of TD-0212, an Orally Active Dual Pharmacology AT1 Antagonist and Neprilysin Inhibitor (ARNI).  [PMID:30655952]

Source