The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3,4-trimethoxy-N-(4-sulfamoylphenylcarbamothioyl)benzamide ID: ALA2298027
PubChem CID: 76324170
Max Phase: Preclinical
Molecular Formula: C17H19N3O6S2
Molecular Weight: 425.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)NC(=S)Nc2ccc(S(N)(=O)=O)cc2)c(OC)c1OC
Standard InChI: InChI=1S/C17H19N3O6S2/c1-24-13-9-8-12(14(25-2)15(13)26-3)16(21)20-17(27)19-10-4-6-11(7-5-10)28(18,22)23/h4-9H,1-3H3,(H2,18,22,23)(H2,19,20,21,27)
Standard InChI Key: VHDFPWKESGSWFS-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
11.7240 -18.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7229 -19.1815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4309 -19.5905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1406 -19.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1378 -18.3584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4291 -17.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8439 -17.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5532 -18.3531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8409 -17.1300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2593 -17.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9686 -18.3477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2563 -17.1246 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.6747 -17.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3800 -18.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0857 -17.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0830 -17.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3688 -16.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6661 -17.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7887 -16.7033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.4984 -17.1083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3744 -15.9930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1916 -15.9930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4267 -17.1360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1332 -16.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0162 -17.9536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0160 -17.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0149 -19.5896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3075 -19.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
19 21 2 0
19 22 2 0
6 23 1 0
23 24 1 0
1 25 1 0
25 26 1 0
2 27 1 0
27 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.49Molecular Weight (Monoisotopic): 425.0715AlogP: 1.49#Rotatable Bonds: 6Polar Surface Area: 128.98Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.89CX Basic pKa: ┄CX LogP: 1.74CX LogD: 1.74Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.59Np Likeness Score: -1.49
References 1. Saeed A, Zaib S, Pervez A, Mumtaz A, Shahid M, Iqbal J. (2013) Synthesis, molecular docking studies, and in vitro screening of sulfanilamide-thiourea hybrids as antimicrobial and urease inhibitors, 22 (8): [10.1007/s00044-012-0376-4 ]