7-(2-(bis(2-aminoethyl)amino)ethylamino)-4-methyl-2H-chromen-2-one

ID: ALA2298673

PubChem CID: 23625608

Max Phase: Preclinical

Molecular Formula: C16H24N4O2

Molecular Weight: 304.39

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2cc(NCCN(CCN)CCN)ccc12

Standard InChI:  InChI=1S/C16H24N4O2/c1-12-10-16(21)22-15-11-13(2-3-14(12)15)19-6-9-20(7-4-17)8-5-18/h2-3,10-11,19H,4-9,17-18H2,1H3

Standard InChI Key:  AOLVSWDHNWQXPJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   13.6680  -19.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6668  -20.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3749  -20.6553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3731  -19.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0817  -19.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0851  -20.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7975  -20.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5110  -20.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5076  -19.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7907  -19.0054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2141  -19.0066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7997  -21.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9602  -19.0184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2525  -19.4272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2527  -20.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5451  -20.6531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5453  -21.4703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8373  -20.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8371  -19.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1293  -19.0191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8377  -21.8791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1299  -21.4707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
  7 12  1  0
  1 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 17 21  1  0
 21 22  1  0
M  END

Associated Targets(non-human)

LOX1.1 Seed lipoxygenase-1 (463 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 304.39Molecular Weight (Monoisotopic): 304.1899AlogP: 0.73#Rotatable Bonds: 8
Polar Surface Area: 97.52Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.68CX LogP: -0.02CX LogD: -3.90
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.62Np Likeness Score: -0.80

References

1. Bansal Y, Sethi P, Bansal G.  (2013)  Coumarin: a potential nucleus for anti-inflammatory molecules,  22  (7): [10.1007/s00044-012-0321-6]

Source