The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-Chloro-2-(3-fluorophenyl)-4-oxoazetidin-1-yl)-3-(2-oxo-2-(10H-phenothiazin-10-yl)ethyl)urea ID: ALA2298863
PubChem CID: 71731856
Max Phase: Preclinical
Molecular Formula: C24H18ClFN4O3S
Molecular Weight: 496.95
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCC(=O)N1c2ccccc2Sc2ccccc21)NN1C(=O)C(Cl)C1c1cccc(F)c1
Standard InChI: InChI=1S/C24H18ClFN4O3S/c25-21-22(14-6-5-7-15(26)12-14)30(23(21)32)28-24(33)27-13-20(31)29-16-8-1-3-10-18(16)34-19-11-4-2-9-17(19)29/h1-12,21-22H,13H2,(H2,27,28,33)
Standard InChI Key: JBZJYYAHDSYYCF-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
34.3990 -10.3593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3979 -11.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1059 -11.5878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1041 -9.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8128 -10.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8116 -11.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5217 -11.5922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5240 -9.9419 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.2387 -10.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2374 -11.1788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9467 -11.5887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6578 -11.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6551 -10.3544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9452 -9.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5212 -12.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8132 -12.8176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2286 -12.8185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2281 -13.6357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9355 -14.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9350 -14.8619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6435 -13.6366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2278 -15.2691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4152 -15.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3974 -16.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2144 -16.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7191 -14.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7376 -14.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0395 -13.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3224 -13.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3077 -14.7989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0065 -15.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8073 -16.6303 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
37.7813 -16.6708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5929 -15.1950 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
7 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 22 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
23 26 1 0
24 32 1 0
25 33 2 0
30 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.95Molecular Weight (Monoisotopic): 496.0772AlogP: 4.36#Rotatable Bonds: 4Polar Surface Area: 81.75Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.31CX Basic pKa: ┄CX LogP: 3.65CX LogD: 3.64Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -1.04
References 1. Rajasekaran A, Devi KS. (2013) Synthesis and biological evaluation of 1-(3-chloro-2-oxo-4-phenylazetidin-1-yl)-3-(2-oxo-2-(10H-phenothiazin-10-yl)ethyl)urea derivatives, 22 (6): [10.1007/s00044-012-0255-z ]