The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-Chloro-2-(4-hydroxy-3-methoxyphenyl)-4-oxoazetidin-1-yl)-3-(2-oxo-2-(10H-phenothiazin-10-yl)ethyl)urea ID: ALA2298868
PubChem CID: 76335069
Max Phase: Preclinical
Molecular Formula: C25H21ClN4O5S
Molecular Weight: 524.99
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C2C(Cl)C(=O)N2NC(=O)NCC(=O)N2c3ccccc3Sc3ccccc32)ccc1O
Standard InChI: InChI=1S/C25H21ClN4O5S/c1-35-18-12-14(10-11-17(18)31)23-22(26)24(33)30(23)28-25(34)27-13-21(32)29-15-6-2-4-8-19(15)36-20-9-5-3-7-16(20)29/h2-12,22-23,31H,13H2,1H3,(H2,27,28,34)
Standard InChI Key: MJZKXVWWMUBNQF-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
29.6345 -1.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6333 -2.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3481 -3.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3463 -1.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0616 -1.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0604 -2.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7773 -3.1486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7797 -1.4827 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.5011 -1.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4998 -2.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2159 -3.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9337 -2.7311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9309 -1.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2143 -1.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7768 -3.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0620 -4.3857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4909 -4.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4904 -5.2115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2046 -5.6244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2040 -6.4494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9192 -5.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4901 -6.8605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6698 -6.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6518 -7.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4765 -7.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9670 -6.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9858 -5.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2811 -5.1594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5571 -5.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5422 -6.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2477 -6.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0561 -8.2346 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.0488 -8.2755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8509 -5.1302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8207 -6.7857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1136 -6.3608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
7 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 22 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
23 26 1 0
24 32 1 0
25 33 2 0
29 34 1 0
30 35 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.99Molecular Weight (Monoisotopic): 524.0921AlogP: 3.94#Rotatable Bonds: 5Polar Surface Area: 111.21Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.28CX Basic pKa: ┄CX LogP: 3.04CX LogD: 3.04Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -0.42
References 1. Rajasekaran A, Devi KS. (2013) Synthesis and biological evaluation of 1-(3-chloro-2-oxo-4-phenylazetidin-1-yl)-3-(2-oxo-2-(10H-phenothiazin-10-yl)ethyl)urea derivatives, 22 (6): [10.1007/s00044-012-0255-z ]