The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-Chloro-2-oxo-4-phenylazetidin-1-yl)-3-(2-oxo-2-(10H-phenothiazin-10-yl)ethyl)urea ID: ALA2298873
PubChem CID: 76324250
Max Phase: Preclinical
Molecular Formula: C26H21ClN4O3S
Molecular Weight: 505.00
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCC(=O)N1c2ccccc2Sc2ccccc21)NN1C(=O)C(Cl)C1/C=C/c1ccccc1
Standard InChI: InChI=1S/C26H21ClN4O3S/c27-24-20(15-14-17-8-2-1-3-9-17)31(25(24)33)29-26(34)28-16-23(32)30-18-10-4-6-12-21(18)35-22-13-7-5-11-19(22)30/h1-15,20,24H,16H2,(H2,28,29,34)/b15-14+
Standard InChI Key: CVEIOKXTVKKUGM-CCEZHUSRSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
1.3895 -1.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3883 -2.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0964 -2.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0946 -1.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8032 -1.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8020 -2.4394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5121 -2.8508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5145 -1.2004 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.2291 -1.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2278 -2.4374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9372 -2.8472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6482 -2.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6455 -1.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9356 -1.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5116 -3.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8036 -4.0761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2190 -4.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2185 -4.8942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9260 -5.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9254 -6.1204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6339 -4.8951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2182 -6.5276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4056 -6.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3878 -7.3235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2048 -7.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7095 -6.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7281 -5.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7977 -7.8888 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.7717 -7.9293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0298 -4.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0504 -4.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3530 -3.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6352 -3.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6192 -4.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3172 -5.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
7 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 22 1 0
26 27 2 0
23 26 1 0
24 28 1 0
25 29 2 0
27 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.00Molecular Weight (Monoisotopic): 504.1023AlogP: 4.56#Rotatable Bonds: 5Polar Surface Area: 81.75Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.66CX Basic pKa: ┄CX LogP: 4.12CX LogD: 4.11Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -0.58
References 1. Rajasekaran A, Devi KS. (2013) Synthesis and biological evaluation of 1-(3-chloro-2-oxo-4-phenylazetidin-1-yl)-3-(2-oxo-2-(10H-phenothiazin-10-yl)ethyl)urea derivatives, 22 (6): [10.1007/s00044-012-0255-z ]