The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-Chlorobenzyl)-2-[(3-phenyl-2-oxo-2H-[1,2,4]triazino[2,3-c]quinazoline-6-yl)thio]acetamide ID: ALA2299063
PubChem CID: 47082779
Max Phase: Preclinical
Molecular Formula: C25H18ClN5O2S
Molecular Weight: 487.97
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1nc2ccccc2c2nc(=O)c(-c3ccccc3)nn12)NCc1ccccc1Cl
Standard InChI: InChI=1S/C25H18ClN5O2S/c26-19-12-6-4-10-17(19)14-27-21(32)15-34-25-28-20-13-7-5-11-18(20)23-29-24(33)22(30-31(23)25)16-8-2-1-3-9-16/h1-13H,14-15H2,(H,27,32)
Standard InChI Key: DAVVMDOBWUPOLG-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
9.7447 -13.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7434 -14.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4583 -15.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4565 -13.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1719 -13.8134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1707 -14.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6036 -13.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8861 -13.3978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3191 -13.4046 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.0325 -13.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7480 -13.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4615 -13.8222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7500 -12.5830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1770 -13.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6024 -14.6438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8840 -15.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8804 -15.8775 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5936 -16.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3121 -15.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3174 -15.0561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5889 -17.1211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0244 -16.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8905 -13.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8831 -14.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5957 -15.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3122 -14.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3115 -13.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5984 -13.4150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5969 -12.5900 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.0182 -17.1265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7297 -17.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4473 -17.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4490 -16.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7369 -15.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 16 1 0
15 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
15 16 1 0
15 20 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
18 21 2 0
19 22 1 0
14 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
22 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 22 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.97Molecular Weight (Monoisotopic): 487.0870AlogP: 4.37#Rotatable Bonds: 6Polar Surface Area: 89.25Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.85CX LogP: 4.78CX LogD: 4.78Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.22Np Likeness Score: -2.01
References 1. Kovalenko SI, Nosulenko IS, Voskoboynik AY, Berest GG, Antipenko LN, Antipenko AN, Katsev AM. (2013) Novel N-aryl(alkaryl)-2-[(3-R-2-oxo-2H-[1,2,4]triazino[2,3-c]quinazoline-6-yl)thio]acetamides: synthesis, cytotoxicity, anticancer activity, COMPARE analysis and docking, 22 (6): [10.1007/s00044-012-0257-x ]