The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
halisulfate 5 ID: ALA230057
PubChem CID: 23679843
Max Phase: Preclinical
Molecular Formula: C25H39NaO5S
Molecular Weight: 452.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Halisulfate 5 | CHEMBL230057|halisulfate 5
Canonical SMILES: C=C1CCC[C@@H]2[C@@](C)(CCC(CCCc3ccoc3)COS(=O)(=O)[O-])[C@H](C)CC[C@]12C.[Na+]
Standard InChI: InChI=1S/C25H40O5S.Na/c1-19-7-5-10-23-24(19,3)14-11-20(2)25(23,4)15-12-21(18-30-31(26,27)28)8-6-9-22-13-16-29-17-22;/h13,16-17,20-21,23H,1,5-12,14-15,18H2,2-4H3,(H,26,27,28);/q;+1/p-1/t20-,21?,23+,24-,25+;/m1./s1
Standard InChI Key: FUNAPIOWJXZYRS-PPINXSLVSA-M
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
7.9833 -6.1250 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
9.2958 -7.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2958 -8.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0079 -8.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0079 -7.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7199 -7.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7164 -8.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4251 -8.7382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1419 -8.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1455 -7.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4321 -7.0882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7125 -6.6750 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.7083 -9.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0087 -9.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4250 -7.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8621 -7.0973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4352 -6.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1512 -5.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1542 -5.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8702 -4.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5832 -5.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2992 -4.6238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0121 -5.0390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0965 -5.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9028 -6.0299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3180 -5.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7681 -4.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4413 -4.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7253 -5.0231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0124 -4.6080 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.2917 -4.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4263 -3.8943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6048 -5.3253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
11 17 1 0
3 4 1 0
17 18 1 0
4 7 1 0
19 18 1 0
6 11 1 0
19 20 1 0
7 8 1 0
20 21 1 0
8 9 1 0
21 22 1 0
9 10 1 0
22 23 1 0
23 24 2 0
10 11 1 0
6 5 1 0
6 12 1 1
6 7 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 23 1 0
7 13 1 1
19 28 1 0
28 29 1 0
4 14 2 0
29 30 1 0
2 3 1 0
30 31 1 0
11 15 1 6
30 32 2 0
30 33 2 0
10 16 1 6
M CHG 2 1 1 31 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.66Molecular Weight (Monoisotopic): 452.2596AlogP: 6.62#Rotatable Bonds: 10Polar Surface Area: 76.74Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: -1.51CX Basic pKa: ┄CX LogP: 5.22CX LogD: 4.33Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: 2.72
References 1. Lee HS, Lee TH, Yang SH, Shin HJ, Shin J, Oh KB.. (2007) Sesterterpene sulfates as isocitrate lyase inhibitors from tropical sponge Hippospongia sp., 17 (9): [PMID:17317180 ] [10.1016/j.bmcl.2007.02.027 ]