The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
polysulfonated derivative ID: ALA2303820
PubChem CID: 71717837
Max Phase: Preclinical
Molecular Formula: C21H22O14S2
Molecular Weight: 562.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H]1O[C@@H](COS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1
Standard InChI: InChI=1S/C21H22O14S2/c1-30-21-18(34-20(23)14-10-6-3-7-11-14)17(33-19(22)13-8-4-2-5-9-13)16(35-37(27,28)29)15(32-21)12-31-36(24,25)26/h2-11,15-18,21H,12H2,1H3,(H,24,25,26)(H,27,28,29)/t15-,16+,17-,18-,21+/m0/s1
Standard InChI Key: MAOIOOBWDWIHAO-VPMQLGLMSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
5.5457 0.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4942 0.3827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2294 0.9319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1353 -0.2995 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.3179 2.2423 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.8702 0.6323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0891 0.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1670 -0.9777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7771 0.8487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9061 -1.2523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7926 -1.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5316 -1.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6429 0.3495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8702 1.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5774 1.8804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6236 -0.9485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0376 2.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4821 0.2122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7843 -0.7988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9061 2.9579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7298 1.5185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9731 -1.7640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7162 -2.0386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9892 -2.6751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2461 -2.4005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6424 -0.5284 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8717 -3.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0657 -2.3506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6148 -3.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8047 -2.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4495 -0.3537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0683 -4.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2623 -3.3116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3210 -3.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5192 -3.0370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8920 -4.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1447 -3.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 13 1 0
5 15 1 0
6 3 1 0
7 2 1 0
1 8 1 1
9 6 1 0
2 10 1 6
11 8 1 0
12 10 1 0
3 13 1 6
6 14 1 1
15 14 1 0
16 4 1 0
17 5 1 0
18 4 2 0
19 4 2 0
20 5 2 0
21 5 2 0
22 11 2 0
23 12 2 0
24 12 1 0
25 11 1 0
7 26 1 1
27 25 2 0
28 25 1 0
29 24 2 0
30 24 1 0
31 26 1 0
32 29 1 0
33 30 2 0
34 27 1 0
35 28 2 0
36 33 1 0
37 35 1 0
7 9 1 0
37 34 2 0
36 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.53Molecular Weight (Monoisotopic): 562.0451AlogP: 0.82#Rotatable Bonds: 10Polar Surface Area: 198.26Molecular Species: ACIDHBA: 12HBD: 2#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: -2.52CX Basic pKa: ┄CX LogP: 2.81CX LogD: -1.94Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: 1.11
References 1. Bytheway I, Cochran S.. (2004) Validation of molecular docking calculations involving FGF-1 and FGF-2., 47 (7): [PMID:15027859 ] [10.1021/jm030447t ]