The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-benzyl-2-(3-(2-(2-hydroxy-2-(4-hydroxy-3-(hydroxymethyl)phenyl)ethylamino)-2-methylpropyl)phenyl)acetamide ID: ALA230486
PubChem CID: 11259765
Max Phase: Preclinical
Molecular Formula: C28H34N2O4
Molecular Weight: 462.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(Cc1cccc(CC(=O)NCc2ccccc2)c1)NC[C@H](O)c1ccc(O)c(CO)c1
Standard InChI: InChI=1S/C28H34N2O4/c1-28(2,30-18-26(33)23-11-12-25(32)24(15-23)19-31)16-22-10-6-9-21(13-22)14-27(34)29-17-20-7-4-3-5-8-20/h3-13,15,26,30-33H,14,16-19H2,1-2H3,(H,29,34)/t26-/m0/s1
Standard InChI Key: RJMSFLODFKHYEI-SANMLTNESA-N
Molfile:
RDKit 2D
34 36 0 0 1 0 0 0 0 0999 V2000
-2.3787 -2.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9632 -2.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1390 -2.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7230 -2.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1388 -3.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9646 -3.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3790 -1.5455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7289 -4.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0999 -4.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1395 -5.1327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5102 -3.6995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3395 -3.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1646 -3.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5793 -4.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1627 -5.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5727 -5.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3837 -5.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7956 -5.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3861 -4.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6264 -5.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0368 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8661 -4.4263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6243 -3.7135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8014 -3.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3863 -2.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7970 -2.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3904 -1.5896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5792 -1.5896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1702 -2.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5803 -3.0121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7228 -1.5447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1008 -1.5447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3395 -4.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3395 -2.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
5 8 1 0
8 9 1 0
8 10 1 6
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
18 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
3 31 1 0
31 32 1 0
12 33 1 0
12 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.59Molecular Weight (Monoisotopic): 462.2519AlogP: 3.39#Rotatable Bonds: 11Polar Surface Area: 101.82Molecular Species: BASEHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.46CX Basic pKa: 10.17CX LogP: 2.75CX LogD: 1.02Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -0.16
References 1. Brown AD, Bunnage ME, Glossop PA, James K, Jones R, Lane CA, Lewthwaite RA, Mantell S, Perros-Huguet C, Price DA, Trevethick M, Webster R.. (2007) The discovery of long acting beta2-adrenoreceptor agonists., 17 (14): [PMID:17498952 ] [10.1016/j.bmcl.2007.04.081 ]