(R)-N-benzyl-2-(3-(2-(2-hydroxy-2-(4-hydroxy-3-(hydroxymethyl)phenyl)ethylamino)-2-methylpropyl)phenyl)acetamide

ID: ALA230486

PubChem CID: 11259765

Max Phase: Preclinical

Molecular Formula: C28H34N2O4

Molecular Weight: 462.59

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(Cc1cccc(CC(=O)NCc2ccccc2)c1)NC[C@H](O)c1ccc(O)c(CO)c1

Standard InChI:  InChI=1S/C28H34N2O4/c1-28(2,30-18-26(33)23-11-12-25(32)24(15-23)19-31)16-22-10-6-9-21(13-22)14-27(34)29-17-20-7-4-3-5-8-20/h3-13,15,26,30-33H,14,16-19H2,1-2H3,(H,29,34)/t26-/m0/s1

Standard InChI Key:  RJMSFLODFKHYEI-SANMLTNESA-N

Molfile:  

     RDKit          2D

 34 36  0  0  1  0  0  0  0  0999 V2000
   -2.3787   -2.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9632   -2.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1390   -2.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7230   -2.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1388   -3.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9646   -3.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3790   -1.5455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7289   -4.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0999   -4.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1395   -5.1327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5102   -3.6995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3395   -3.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1646   -3.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5793   -4.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1627   -5.1359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5727   -5.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3837   -5.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7956   -5.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3861   -4.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6264   -5.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0368   -4.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8661   -4.4263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6243   -3.7135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8014   -3.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3863   -2.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7970   -2.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3904   -1.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5792   -1.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1702   -2.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5803   -3.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7228   -1.5447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1008   -1.5447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3395   -4.5288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3395   -2.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  5  8  1  0
  8  9  1  0
  8 10  1  6
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
  3 31  1  0
 31 32  1  0
 12 33  1  0
 12 34  1  0
M  END

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB1 Tclin Adrenergic receptor beta; ADRB1 & ADRB2 (240 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.59Molecular Weight (Monoisotopic): 462.2519AlogP: 3.39#Rotatable Bonds: 11
Polar Surface Area: 101.82Molecular Species: BASEHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 9.46CX Basic pKa: 10.17CX LogP: 2.75CX LogD: 1.02
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -0.16

References

1. Brown AD, Bunnage ME, Glossop PA, James K, Jones R, Lane CA, Lewthwaite RA, Mantell S, Perros-Huguet C, Price DA, Trevethick M, Webster R..  (2007)  The discovery of long acting beta2-adrenoreceptor agonists.,  17  (14): [PMID:17498952] [10.1016/j.bmcl.2007.04.081]

Source