N-benzyl-2-(3-((R)-2-((R)-2-hydroxy-2-(4-hydroxy-3-(hydroxymethyl)phenyl)ethylamino)propyl)phenyl)acetamide

ID: ALA230487

PubChem CID: 44425580

Max Phase: Preclinical

Molecular Formula: C27H32N2O4

Molecular Weight: 448.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](Cc1cccc(CC(=O)NCc2ccccc2)c1)NC[C@H](O)c1ccc(O)c(CO)c1

Standard InChI:  InChI=1S/C27H32N2O4/c1-19(28-17-26(32)23-10-11-25(31)24(15-23)18-30)12-21-8-5-9-22(13-21)14-27(33)29-16-20-6-3-2-4-7-20/h2-11,13,15,19,26,28,30-32H,12,14,16-18H2,1H3,(H,29,33)/t19-,26+/m1/s1

Standard InChI Key:  BNWMNRFNCJDJEV-BCHFMIIMSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  1  0  0  0  0  0999 V2000
   -3.8514   -7.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8526   -8.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1378   -8.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4213   -8.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4242   -7.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1396   -6.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5674   -8.5268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7113   -6.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9953   -7.2784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7144   -6.0436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2823   -6.8633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4337   -7.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1466   -6.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4368   -8.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8626   -7.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8628   -8.0928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5780   -8.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2919   -8.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2861   -7.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5704   -6.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9976   -6.8403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7150   -7.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7211   -8.0725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4265   -6.8299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1439   -7.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8554   -6.8194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5694   -7.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2804   -6.8123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2748   -5.9865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5523   -5.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8443   -5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1380   -9.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8525   -9.7650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  8  1  0
 16 17  1  0
 17 18  2  0
  8  9  1  0
 18 19  1  0
  4  5  1  0
 19 20  2  0
 20 15  1  0
  8 10  1  1
 19 21  1  0
  2  3  1  0
 21 22  1  0
  9 11  1  0
 22 23  2  0
  5  6  2  0
 22 24  1  0
 11 12  1  0
 24 25  1  0
  6  1  1  0
 25 26  1  0
 12 13  1  0
 26 27  2  0
  1  2  2  0
 27 28  1  0
 12 14  1  1
 28 29  2  0
  2  7  1  0
 29 30  1  0
 13 15  1  0
 30 31  2  0
 31 26  1  0
  3  4  2  0
  3 32  1  0
 15 16  2  0
 32 33  1  0
M  END

Associated Targets(Human)

ADRB2 Tclin Beta-2 adrenergic receptor (11824 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADRB1 Tclin Adrenergic receptor beta; ADRB1 & ADRB2 (240 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.56Molecular Weight (Monoisotopic): 448.2362AlogP: 3.00#Rotatable Bonds: 11
Polar Surface Area: 101.82Molecular Species: BASEHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 10.13CX Basic pKa: 9.42CX LogP: 2.50CX LogD: 0.82
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.19

References

1. Brown AD, Bunnage ME, Glossop PA, James K, Jones R, Lane CA, Lewthwaite RA, Mantell S, Perros-Huguet C, Price DA, Trevethick M, Webster R..  (2007)  The discovery of long acting beta2-adrenoreceptor agonists.,  17  (14): [PMID:17498952] [10.1016/j.bmcl.2007.04.081]

Source