2-[6-Amino-2-(3-phenyl-propoxy)-purin-9-yl]-5-hydroxymethyl-tetrahydro-furan-3,4-diol

ID: ALA2311199

PubChem CID: 71716086

Max Phase: Preclinical

Molecular Formula: C19H23N5O5

Molecular Weight: 401.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1nc(OCCCc2ccccc2)nc2c1ncn2[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C19H23N5O5/c20-16-13-17(24(10-21-13)18-15(27)14(26)12(9-25)29-18)23-19(22-16)28-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,10,12,14-15,18,25-27H,4,7-9H2,(H2,20,22,23)/t12-,14-,15-,18-/m0/s1

Standard InChI Key:  UDWLAWJOABGYPL-OWCBBSPXSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  1  0  0  0  0  0999 V2000
   21.7771  -13.3697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0338  -13.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7771  -15.1142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0338  -12.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3353  -13.5452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7771  -12.0759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2210  -16.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2553  -12.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6230  -12.3168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9332  -14.4811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3353  -11.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6230  -13.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6352  -16.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0687  -15.1142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7461  -16.7728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3353  -11.1159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1031  -16.7555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9108  -13.5314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0687  -14.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0583  -13.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9255  -14.4811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1985  -13.1116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7739  -13.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3494  -13.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0514  -14.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4862  -13.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3391  -14.7426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6338  -13.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6268  -14.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  1
  4  2  2  0
  5  2  1  0
  6  8  2  0
  7  3  1  0
  8  1  1  0
  9 12  1  0
 10  3  1  0
 11  4  1  0
 12  5  2  0
 13  7  1  0
 14 10  1  0
  7 15  1  6
 16 11  1  0
 13 17  1  6
 18 12  1  0
 14 19  1  1
 20 23  1  0
 21 19  1  0
 22 18  1  0
 23 26  1  0
 24 20  2  0
 25 20  1  0
 26 22  1  0
 27 25  2  0
 28 24  1  0
 29 27  1  0
  6  4  1  0
 14 13  1  0
  9 11  2  0
 29 28  2  0
M  END

Associated Targets(Human)

ADORA2B Tclin Adenosine A2 receptor (1064 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ADORA1 Tclin Adenosine receptors; A1 & A2 (188 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

ADORA1 Adenosine A1 receptor (540 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.42Molecular Weight (Monoisotopic): 401.1699AlogP: 0.03#Rotatable Bonds: 7
Polar Surface Area: 148.77Molecular Species: NEUTRALHBA: 10HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 12.45CX Basic pKa: 4.22CX LogP: 0.89CX LogD: 0.89
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.40Np Likeness Score: 0.62

References

1. Ueeda M, Thompson RD, Arroyo LH, Olsson RA..  (1991)  2-aralkoxyadenosines: potent and selective agonists at the coronary artery A2 adenosine receptor.,  34  (4): [PMID:2016708] [10.1021/jm00108a015]

Source