2-cyano-3-(1-(2-hydroxy-3-(pyrrolidin-1-yl)propyl)-2-methyl-1H-indol-3-yl)-N-octylacrylamide

ID: ALA2312415

PubChem CID: 71716723

Max Phase: Preclinical

Molecular Formula: C28H40N4O2

Molecular Weight: 464.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCNC(=O)/C(C#N)=C/c1c(C)n(CC(O)CN2CCCC2)c2ccccc12

Standard InChI:  InChI=1S/C28H40N4O2/c1-3-4-5-6-7-10-15-30-28(34)23(19-29)18-26-22(2)32(27-14-9-8-13-25(26)27)21-24(33)20-31-16-11-12-17-31/h8-9,13-14,18,24,33H,3-7,10-12,15-17,20-21H2,1-2H3,(H,30,34)/b23-18+

Standard InChI Key:  DQHIJWOMMVYHCW-PTGBLXJZSA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    7.6758   -7.9828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2134   -8.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1041   -7.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2551   -5.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7988   -7.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8447   -6.5531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8198   -8.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6070   -9.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3196   -6.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5592   -7.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0801   -5.8350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1059   -8.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0384   -8.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8910   -9.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2126  -11.1491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4112  -12.2161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3912   -8.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4349  -10.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9382  -11.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3923   -7.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7342   -7.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6099   -8.6160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4947   -6.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2001  -11.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1780   -9.4365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8195   -7.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0986   -7.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0197   -6.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6093   -7.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8885  -10.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9738   -7.9698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2611   -7.2696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8405   -5.1242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9236   -7.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 27 29  2  0
 14 30  1  0
 11 23  1  0
  5  2  1  0
 18 19  1  0
  4 33  2  0
  8 14  1  0
 29 26  1  0
  3 20  1  0
  6  4  1  0
  4 11  1  0
 19 16  1  0
 23  9  1  0
  6 32  1  0
 12  7  2  0
  2 13  1  0
 16 24  1  0
 30 15  1  0
 32  1  3  0
  9 21  1  0
 28  6  2  0
 10 31  1  0
  7 22  1  0
 26  7  1  0
 17 12  1  0
 22  8  1  0
 20 17  2  0
 29 28  1  0
 26  3  2  0
 15 18  1  0
 21 10  1  0
 31  5  1  0
 24 15  1  0
 14 25  1  0
 22 27  1  0
 27 34  1  0
M  END

Associated Targets(Human)

DNM2 Tchem Dynamin-2 (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.65Molecular Weight (Monoisotopic): 464.3151AlogP: 4.79#Rotatable Bonds: 13
Polar Surface Area: 81.29Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.54CX LogP: 4.78CX LogD: 2.65
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -1.01

References

1. Gordon CP, Venn-Brown B, Robertson MJ, Young KA, Chau N, Mariana A, Whiting A, Chircop M, Robinson PJ, McCluskey A..  (2013)  Development of second-generation indole-based dynamin GTPase inhibitors.,  56  (1): [PMID:23167654] [10.1021/jm300844m]

Source