N-((1-(3-(Dimethylamino)propyl)-1H-indol-3-yl)methyl)octan-1-amine

ID: ALA2312428

PubChem CID: 71546812

Max Phase: Preclinical

Molecular Formula: C22H37N3

Molecular Weight: 343.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCNCc1cn(CCCN(C)C)c2ccccc12

Standard InChI:  InChI=1S/C22H37N3/c1-4-5-6-7-8-11-15-23-18-20-19-25(17-12-16-24(2)3)22-14-10-9-13-21(20)22/h9-10,13-14,19,23H,4-8,11-12,15-18H2,1-3H3

Standard InChI Key:  RDRFARHAZRCRNL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
    0.7944  -28.0162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7932  -28.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5081  -29.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5062  -27.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2216  -28.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2219  -28.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0124  -29.1001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5007  -28.4276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0115  -27.7563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4218  -27.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4435  -29.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0500  -30.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4813  -31.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0878  -31.9569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5191  -32.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2631  -31.9787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2468  -27.0381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6571  -26.3225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4821  -26.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8925  -25.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7175  -25.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1279  -24.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9529  -24.8838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3632  -24.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1882  -24.1656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
  7 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
M  END

Associated Targets(Human)

DNM2 Tchem Dynamin-2 (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 343.56Molecular Weight (Monoisotopic): 343.2987AlogP: 5.04#Rotatable Bonds: 13
Polar Surface Area: 20.20Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.03CX LogP: 5.03CX LogD: 0.47
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.51Np Likeness Score: -1.05

References

1. Gordon CP, Venn-Brown B, Robertson MJ, Young KA, Chau N, Mariana A, Whiting A, Chircop M, Robinson PJ, McCluskey A..  (2013)  Development of second-generation indole-based dynamin GTPase inhibitors.,  56  (1): [PMID:23167654] [10.1021/jm300844m]

Source