N-(1-(3-Dimethylaminopropyl)-1H-indol-3-ylmethyl)-tetradecylamine

ID: ALA2312432

PubChem CID: 71546961

Max Phase: Preclinical

Molecular Formula: C28H49N3

Molecular Weight: 427.72

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCNCc1cn(CCCN(C)C)c2ccccc12

Standard InChI:  InChI=1S/C28H49N3/c1-4-5-6-7-8-9-10-11-12-13-14-17-21-29-24-26-25-31(23-18-22-30(2)3)28-20-16-15-19-27(26)28/h15-16,19-20,25,29H,4-14,17-18,21-24H2,1-3H3

Standard InChI Key:  FHXHUSJGTRNFBL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   10.6026   -5.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6014   -6.4731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3162   -6.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3144   -5.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0298   -5.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0301   -6.4731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8206   -6.7296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3088   -6.0572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8196   -5.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2300   -4.6701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2517   -7.4329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8582   -8.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2895   -8.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8960   -9.5865    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3272  -10.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0713   -9.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0549   -4.6677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4653   -3.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2903   -3.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7007   -3.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5257   -3.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9361   -2.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7610   -2.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1714   -1.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9963   -1.7951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4067   -1.0794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2317   -1.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6421   -0.3613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4671   -0.3588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8774    0.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7024    0.3657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
  7 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Associated Targets(Human)

DNM2 Tchem Dynamin-2 (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.72Molecular Weight (Monoisotopic): 427.3926AlogP: 7.38#Rotatable Bonds: 19
Polar Surface Area: 20.20Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.03CX LogP: 7.70CX LogD: 3.13
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.24Np Likeness Score: -0.85

References

1. Gordon CP, Venn-Brown B, Robertson MJ, Young KA, Chau N, Mariana A, Whiting A, Chircop M, Robinson PJ, McCluskey A..  (2013)  Development of second-generation indole-based dynamin GTPase inhibitors.,  56  (1): [PMID:23167654] [10.1021/jm300844m]

Source