The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 6-[(6-(3-Aminopropyl)-5,11-dioxo-6,11-dihydro-5Hindeno[1,2-c]isoquinolin-3-yl)amino]-6-oxohexanoate ID: ALA2312883
PubChem CID: 71546672
Max Phase: Preclinical
Molecular Formula: C26H27N3O5
Molecular Weight: 461.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CCCCC(=O)Nc1ccc2c3c(n(CCCN)c(=O)c2c1)-c1ccccc1C3=O
Standard InChI: InChI=1S/C26H27N3O5/c1-34-22(31)10-5-4-9-21(30)28-16-11-12-17-20(15-16)26(33)29(14-6-13-27)24-18-7-2-3-8-19(18)25(32)23(17)24/h2-3,7-8,11-12,15H,4-6,9-10,13-14,27H2,1H3,(H,28,30)
Standard InChI Key: GEXCLCBUDZLREW-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
8.3192 -29.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3180 -30.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0286 -30.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0268 -29.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7380 -29.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7414 -30.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4564 -30.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1726 -30.2683 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4496 -29.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1697 -29.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6232 -28.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4505 -28.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7884 -28.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6128 -28.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1001 -28.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7572 -27.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9339 -27.4580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4587 -31.5063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8839 -30.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0750 -27.6012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6027 -30.6832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8891 -30.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1737 -30.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8908 -29.4443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4602 -30.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7449 -30.6773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0313 -30.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3160 -30.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -30.2604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3143 -31.4993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6041 -29.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5983 -30.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3128 -30.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0272 -30.2668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 2 0
10 13 1 0
12 11 1 0
11 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
7 18 2 0
8 19 1 0
11 20 2 0
2 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
19 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.52Molecular Weight (Monoisotopic): 461.1951AlogP: 3.23#Rotatable Bonds: 9Polar Surface Area: 120.49Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.63CX Basic pKa: 9.57CX LogP: 1.48CX LogD: -0.64Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -0.24
References 1. Conda-Sheridan M, Reddy PV, Morrell A, Cobb BT, Marchand C, Agama K, Chergui A, Renaud A, Stephen AG, Bindu LK, Pommier Y, Cushman M.. (2013) Synthesis and biological evaluation of indenoisoquinolines that inhibit both tyrosyl-DNA phosphodiesterase I (Tdp1) and topoisomerase I (Top1)., 56 (1): [PMID:23259865 ] [10.1021/jm3014458 ] 2. Conda-Sheridan M, Park EJ, Beck DE, Reddy PV, Nguyen TX, Hu B, Chen L, White JJ, van Breemen RB, Pezzuto JM, Cushman M.. (2013) Design, synthesis, and biological evaluation of indenoisoquinoline rexinoids with chemopreventive potential., 56 (6): [PMID:23472886 ] [10.1021/jm400026k ]