The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-chlorophenyl)-5-((3-fluoro-4-morpholinophenyl)(hydroxy)methyl)-4-methoxyfuran-2(5H)-one ID: ALA2314592
PubChem CID: 71521289
Max Phase: Preclinical
Molecular Formula: C22H21ClFNO5
Molecular Weight: 433.86
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC1=C(c2ccc(Cl)cc2)C(=O)OC1C(O)c1ccc(N2CCOCC2)c(F)c1
Standard InChI: InChI=1S/C22H21ClFNO5/c1-28-20-18(13-2-5-15(23)6-3-13)22(27)30-21(20)19(26)14-4-7-17(16(24)12-14)25-8-10-29-11-9-25/h2-7,12,19,21,26H,8-11H2,1H3
Standard InChI Key: YZGLTMYTBNGJFV-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-0.4694 -5.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4682 -6.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2498 -7.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9661 -6.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9633 -5.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2479 -5.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6769 -7.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6967 -7.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4873 -8.0804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9561 -7.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4552 -6.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6912 -5.9555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0411 -8.3452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7808 -7.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2103 -8.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8118 -8.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2406 -9.5096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0662 -9.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4612 -8.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0300 -8.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4938 -5.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1760 -6.6574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2858 -8.7382 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4968 -10.1939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1006 -10.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5276 -11.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3528 -11.6005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7492 -10.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3205 -10.1681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1798 -5.3708 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 2 0
4 7 1 0
11 12 1 0
8 13 2 0
10 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
12 21 1 0
14 22 1 0
19 23 1 0
18 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
1 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.86Molecular Weight (Monoisotopic): 433.1092AlogP: 3.33#Rotatable Bonds: 5Polar Surface Area: 68.23Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.66CX Basic pKa: ┄CX LogP: 3.44CX LogD: 3.44Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.73Np Likeness Score: -0.42
References 1. Xu HW, Xu C, Fan ZQ, Zhao LJ, Liu HM.. (2013) A facile synthesis, antibacterial activity of pulvinone and its derivatives., 23 (3): [PMID:23265890 ] [10.1016/j.bmcl.2012.11.090 ]