The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,3'-(((Methylenebis(4,4'-phenylene))bis(oxy))bis(ethane-2,1-diyl))bis(5-(2-hydroxy ethyl)-4-methylthiazol-3-ium)Chloride ID: ALA2314625
PubChem CID: 71520838
Max Phase: Preclinical
Molecular Formula: C29H36Cl2N2O4S2
Molecular Weight: 540.75
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(CCO)sc[n+]1CCOc1ccc(Cc2ccc(OCC[n+]3csc(CCO)c3C)cc2)cc1.[Cl-].[Cl-]
Standard InChI: InChI=1S/C29H36N2O4S2.2ClH/c1-22-28(11-15-32)36-20-30(22)13-17-34-26-7-3-24(4-8-26)19-25-5-9-27(10-6-25)35-18-14-31-21-37-29(12-16-33)23(31)2;;/h3-10,20-21,32-33H,11-19H2,1-2H3;2*1H/q+2;;/p-2
Standard InChI Key: CLQJYLMUESOGCF-UHFFFAOYSA-L
Molfile:
RDKit 2D
39 40 0 0 0 0 0 0 0 0999 V2000
17.7375 -5.1583 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.2519 -5.8864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5157 -6.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3406 -6.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5843 -5.8672 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.9099 -5.3920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0395 -7.3411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8350 -7.3159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5104 -8.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0049 -8.7347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8229 -5.8821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1666 -6.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9916 -6.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2491 -5.8403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5791 -5.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9150 -5.8403 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.9656 -5.4313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6780 -5.8473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7458 -7.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1513 -8.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7317 -8.7664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4756 -7.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3945 -5.4383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1069 -5.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1015 -6.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8131 -7.0962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5306 -6.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5320 -5.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8198 -5.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2436 -7.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9595 -6.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6710 -7.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3864 -6.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3899 -5.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6719 -5.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9593 -5.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1052 -5.4649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5386 -5.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1042 -4.6250 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
3 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
14 17 1 0
17 18 1 0
12 19 1 0
19 20 1 0
20 21 1 0
13 22 1 0
18 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
37 11 1 0
11 38 1 0
38 2 1 0
M CHG 4 1 -1 2 1 14 1 39 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.75Molecular Weight (Monoisotopic): 540.2106AlogP: 3.82#Rotatable Bonds: 14Polar Surface Area: 66.68Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -2.75CX LogD: -2.75Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -0.06
References 1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S.. (2013) New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation., 56 (2): [PMID:23289711 ] [10.1021/jm3014585 ]