3,3'-(((Methylenebis(4,4'-phenylene))bis(oxy))bis(ethane-2,1-diyl))bis(5-(2-hydroxy ethyl)-4-methylthiazol-3-ium)Chloride

ID: ALA2314625

PubChem CID: 71520838

Max Phase: Preclinical

Molecular Formula: C29H36Cl2N2O4S2

Molecular Weight: 540.75

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(CCO)sc[n+]1CCOc1ccc(Cc2ccc(OCC[n+]3csc(CCO)c3C)cc2)cc1.[Cl-].[Cl-]

Standard InChI:  InChI=1S/C29H36N2O4S2.2ClH/c1-22-28(11-15-32)36-20-30(22)13-17-34-26-7-3-24(4-8-26)19-25-5-9-27(10-6-25)35-18-14-31-21-37-29(12-16-33)23(31)2;;/h3-10,20-21,32-33H,11-19H2,1-2H3;2*1H/q+2;;/p-2

Standard InChI Key:  CLQJYLMUESOGCF-UHFFFAOYSA-L

Molfile:  

     RDKit          2D

 39 40  0  0  0  0  0  0  0  0999 V2000
   17.7375   -5.1583    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.2519   -5.8864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.5157   -6.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3406   -6.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5843   -5.8672    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.9099   -5.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0395   -7.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8350   -7.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5104   -8.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0049   -8.7347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.8229   -5.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1666   -6.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9916   -6.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2491   -5.8403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5791   -5.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9150   -5.8403    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.9656   -5.4313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6780   -5.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7458   -7.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1513   -8.0561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7317   -8.7664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4756   -7.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3945   -5.4383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1069   -5.8543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1015   -6.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8131   -7.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5306   -6.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5320   -5.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8198   -5.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2436   -7.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9595   -6.6922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6710   -7.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3864   -6.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3899   -5.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6719   -5.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9593   -5.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1052   -5.4649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5386   -5.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1042   -4.6250    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  2  2  0
  3  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 14 17  1  0
 17 18  1  0
 12 19  1  0
 19 20  1  0
 20 21  1  0
 13 22  1  0
 18 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 34 37  1  0
 37 11  1  0
 11 38  1  0
 38  2  1  0
M  CHG  4   1  -1   2   1  14   1  39  -1
M  END

Associated Targets(non-human)

Plasmodium vinckei petteri (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.75Molecular Weight (Monoisotopic): 540.2106AlogP: 3.82#Rotatable Bonds: 14
Polar Surface Area: 66.68Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: -2.75CX LogD: -2.75
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -0.06

References

1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S..  (2013)  New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation.,  56  (2): [PMID:23289711] [10.1021/jm3014585]

Source