The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,3'-(((Methylenebis(4,4'-phenylene))bis(oxy))bis(ethane-2,1-diyl))bis(5-(2-methoxyethyl)-4-methylthiazol-3-ium)Chloride ID: ALA2314626
PubChem CID: 71520840
Max Phase: Preclinical
Molecular Formula: C31H40Cl2N2O4S2
Molecular Weight: 568.81
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCCc1sc[n+](CCOc2ccc(Cc3ccc(OCC[n+]4csc(CCOC)c4C)cc3)cc2)c1C.[Cl-].[Cl-]
Standard InChI: InChI=1S/C31H40N2O4S2.2ClH/c1-24-30(13-17-34-3)38-22-32(24)15-19-36-28-9-5-26(6-10-28)21-27-7-11-29(12-8-27)37-20-16-33-23-39-31(25(33)2)14-18-35-4;;/h5-12,22-23H,13-21H2,1-4H3;2*1H/q+2;;/p-2
Standard InChI Key: JHMVGMPHXDMMJY-UHFFFAOYSA-L
Molfile:
RDKit 2D
41 42 0 0 0 0 0 0 0 0999 V2000
3.0000 -12.4042 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.7602 -13.5406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0240 -14.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8489 -14.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0926 -13.5214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.4182 -13.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5478 -14.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3434 -14.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0187 -15.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5132 -16.3888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1885 -17.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3313 -13.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6750 -14.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5000 -14.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7574 -13.4944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0875 -13.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4234 -13.4944 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.4739 -13.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1863 -13.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -14.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6596 -15.7102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2400 -16.4205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6455 -17.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9839 -14.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9028 -13.0924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6153 -13.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6098 -14.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3214 -14.7503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0389 -14.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0403 -13.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3281 -13.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7519 -14.7563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4679 -14.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1793 -14.7652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8948 -14.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8982 -13.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1802 -13.1151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4677 -13.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6136 -13.1191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0469 -13.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2709 -12.3417 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
3 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
15 18 1 0
18 19 1 0
13 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
14 24 1 0
19 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
36 39 1 0
39 12 1 0
12 40 1 0
40 2 1 0
M CHG 4 1 -1 2 1 15 1 41 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.81Molecular Weight (Monoisotopic): 568.2419AlogP: 5.13#Rotatable Bonds: 16Polar Surface Area: 44.68Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -1.47CX LogD: -1.47Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: -0.21
References 1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S.. (2013) New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation., 56 (2): [PMID:23289711 ] [10.1021/jm3014585 ]