The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,3'-(([1,1'-Biphenyl]-4,4'-diylbis(oxy))bis(ethane-2,1-diyl))bis(5-(2-methoxyethyl)-4-methyl thiazol-3-ium)Bromide ID: ALA2314628
PubChem CID: 71520650
Max Phase: Preclinical
Molecular Formula: C30H38Br2N2O4S2
Molecular Weight: 554.78
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCCc1sc[n+](CCOc2ccc(-c3ccc(OCC[n+]4csc(CCOC)c4C)cc3)cc2)c1C.[Br-].[Br-]
Standard InChI: InChI=1S/C30H38N2O4S2.2BrH/c1-23-29(13-17-33-3)37-21-31(23)15-19-35-27-9-5-25(6-10-27)26-7-11-28(12-8-26)36-20-16-32-22-38-30(24(32)2)14-18-34-4;;/h5-12,21-22H,13-20H2,1-4H3;2*1H/q+2;;/p-2
Standard InChI Key: CAQMIOGDHOTPIA-UHFFFAOYSA-L
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
3.9041 -17.0624 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
11.6733 -22.5807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1296 -23.2002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5530 -23.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3573 -23.7243 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.4307 -22.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3079 -23.1255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2291 -24.6670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4101 -24.7659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0862 -25.5246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2671 -25.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9613 -21.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8260 -19.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8199 -20.0947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5325 -20.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2489 -20.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2484 -19.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5353 -18.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9629 -20.5117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6749 -21.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7499 -18.7915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5749 -18.7915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8323 -18.0068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1624 -17.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4984 -18.0068 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.5488 -17.5978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2613 -18.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3291 -19.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7346 -20.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3150 -20.9329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7204 -21.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0589 -19.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9777 -17.6048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6902 -18.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6848 -18.8467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3964 -19.2627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1138 -18.8536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1153 -18.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4030 -17.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1499 -22.1540 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
3 7 1 0
4 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 12 1 0
12 20 1 0
20 2 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
23 26 1 0
26 27 1 0
21 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
22 32 1 0
27 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
37 13 1 0
M CHG 4 1 -1 2 1 23 1 40 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.78Molecular Weight (Monoisotopic): 554.2262AlogP: 5.20#Rotatable Bonds: 15Polar Surface Area: 44.68Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -1.91CX LogD: -1.91Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -0.25
References 1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S.. (2013) New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation., 56 (2): [PMID:23289711 ] [10.1021/jm3014585 ]