3,3'-(((Pentane-1,5-diylbis(oxy))bis(4,1-phenylene))bis-(methylene))bis(5-(2-methoxyethyl)-4-methylthiazol-3-ium)Chloride

ID: ALA2314629

PubChem CID: 71520652

Max Phase: Preclinical

Molecular Formula: C33H44Cl2N2O4S2

Molecular Weight: 596.86

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCCc1sc[n+](Cc2ccc(OCCCCCOc3ccc(C[n+]4csc(CCOC)c4C)cc3)cc2)c1C.[Cl-].[Cl-]

Standard InChI:  InChI=1S/C33H44N2O4S2.2ClH/c1-26-32(16-20-36-3)40-24-34(26)22-28-8-12-30(13-9-28)38-18-6-5-7-19-39-31-14-10-29(11-15-31)23-35-25-41-33(27(35)2)17-21-37-4;;/h8-15,24-25H,5-7,16-23H2,1-4H3;2*1H/q+2;;/p-2

Standard InChI Key:  VVDKGIPPQSSQOE-UHFFFAOYSA-L

Molfile:  

     RDKit          2D

 43 44  0  0  0  0  0  0  0  0999 V2000
   16.2705  -17.8122    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.6416  -23.1742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1757  -22.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3825  -22.7229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3590  -23.5502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1349  -23.8244    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.4398  -22.9557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6488  -22.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4446  -21.9398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6537  -21.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4544  -21.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0292  -19.7462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8545  -19.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1180  -18.9702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4519  -18.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7841  -18.9597    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.7529  -20.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2886  -21.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0131  -21.9311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5487  -22.5585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3332  -20.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8319  -18.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5444  -18.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5387  -19.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2503  -20.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9678  -19.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9692  -18.9825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2570  -18.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6808  -20.2268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6778  -21.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3909  -21.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3878  -22.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1009  -22.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0979  -23.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8109  -23.9469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5268  -23.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2348  -23.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9502  -23.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9536  -22.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2356  -22.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5231  -22.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6690  -22.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2954  -21.4996    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  2  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  3 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 12 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 13 21  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 39 42  1  0
 22 14  1  0
 42  4  1  0
M  CHG  4   1  -1   4   1  14   1  43  -1
M  END

Associated Targets(non-human)

Plasmodium vinckei petteri (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 596.86Molecular Weight (Monoisotopic): 596.2732AlogP: 6.10#Rotatable Bonds: 18
Polar Surface Area: 44.68Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: -0.89CX LogD: -0.89
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.10Np Likeness Score: -0.22

References

1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S..  (2013)  New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation.,  56  (2): [PMID:23289711] [10.1021/jm3014585]

Source