The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,3'-(Naphthalene-1,4-diylbis(butane-4,1-diyl))bis(5-(2-hydroxyethyl)-4-methylthiazol-3-ium)Chloride ID: ALA2314636
PubChem CID: 71521373
Max Phase: Preclinical
Molecular Formula: C30H40Cl2N2O2S2
Molecular Weight: 524.80
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(CCO)sc[n+]1CCCCc1ccc(CCCC[n+]2csc(CCO)c2C)c2ccccc12.[Cl-].[Cl-]
Standard InChI: InChI=1S/C30H40N2O2S2.2ClH/c1-23-29(15-19-33)35-21-31(23)17-7-5-9-25-13-14-26(28-12-4-3-11-27(25)28)10-6-8-18-32-22-36-30(16-20-34)24(32)2;;/h3-4,11-14,21-22,33-34H,5-10,15-20H2,1-2H3;2*1H/q+2;;/p-2
Standard InChI Key: GEEVLFVFSUCSIR-UHFFFAOYSA-L
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
14.9246 -15.7163 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.1174 -11.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3739 -11.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4832 -12.6832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2979 -12.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6846 -12.1033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.0837 -10.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3531 -10.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3196 -9.4714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6476 -11.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0335 -14.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7476 -13.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7468 -13.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0362 -15.1119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3390 -15.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8621 -16.3088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1955 -17.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0204 -17.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2779 -16.6941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6079 -16.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9440 -16.6941 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.9943 -16.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7068 -16.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7747 -18.1913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1801 -18.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7605 -19.6201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5044 -18.1470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4232 -16.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1357 -16.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5704 -16.7395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2964 -16.3408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8771 -15.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6011 -15.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6174 -14.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9103 -13.8335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1855 -14.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1728 -15.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3287 -12.4373 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 1 0
2 7 1 0
7 8 1 0
8 9 1 0
3 10 1 0
11 12 1 0
12 13 1 0
13 4 1 0
14 11 1 0
15 14 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 1 0
19 22 1 0
22 23 1 0
17 24 1 0
24 25 1 0
25 26 1 0
18 27 1 0
23 28 1 0
28 29 1 0
29 16 1 0
16 30 2 0
30 31 1 0
31 15 2 0
15 33 1 0
32 16 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 32 2 0
M CHG 4 1 -1 4 1 19 1 38 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.80Molecular Weight (Monoisotopic): 524.2520AlogP: 5.27#Rotatable Bonds: 14Polar Surface Area: 48.22Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -1.34CX LogD: -1.34Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.17Np Likeness Score: 0.07
References 1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S.. (2013) New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation., 56 (2): [PMID:23289711 ] [10.1021/jm3014585 ]