3,3'-(Naphthalene-1,4-diylbis(butane-4,1-diyl))bis(5-(2-hydroxyethyl)-4-methylthiazol-3-ium)Chloride

ID: ALA2314636

PubChem CID: 71521373

Max Phase: Preclinical

Molecular Formula: C30H40Cl2N2O2S2

Molecular Weight: 524.80

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(CCO)sc[n+]1CCCCc1ccc(CCCC[n+]2csc(CCO)c2C)c2ccccc12.[Cl-].[Cl-]

Standard InChI:  InChI=1S/C30H40N2O2S2.2ClH/c1-23-29(15-19-33)35-21-31(23)17-7-5-9-25-13-14-26(28-12-4-3-11-27(25)28)10-6-8-18-32-22-36-30(16-20-34)24(32)2;;/h3-4,11-14,21-22,33-34H,5-10,15-20H2,1-2H3;2*1H/q+2;;/p-2

Standard InChI Key:  GEEVLFVFSUCSIR-UHFFFAOYSA-L

Molfile:  

     RDKit          2D

 38 39  0  0  0  0  0  0  0  0999 V2000
   14.9246  -15.7163    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   23.1174  -11.5056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3739  -11.8645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4832  -12.6832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2979  -12.8297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6846  -12.1033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.0837  -10.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3531  -10.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3196   -9.4714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6476  -11.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0335  -14.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7476  -13.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7468  -13.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0362  -15.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3390  -15.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8621  -16.3088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1955  -17.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0204  -17.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2779  -16.6941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6079  -16.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9440  -16.6941    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.9943  -16.2851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7068  -16.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7747  -18.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1801  -18.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7605  -19.6201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5044  -18.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4232  -16.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1357  -16.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5704  -16.7395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2964  -16.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8771  -15.4828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6011  -15.0848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6174  -14.2607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9103  -13.8335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1855  -14.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1728  -15.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3287  -12.4373    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  2  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  3 10  1  0
 11 12  1  0
 12 13  1  0
 13  4  1  0
 14 11  1  0
 15 14  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  1  0
 19 22  1  0
 22 23  1  0
 17 24  1  0
 24 25  1  0
 25 26  1  0
 18 27  1  0
 23 28  1  0
 28 29  1  0
 29 16  1  0
 16 30  2  0
 30 31  1  0
 31 15  2  0
 15 33  1  0
 32 16  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 32  2  0
M  CHG  4   1  -1   4   1  19   1  38  -1
M  END

Associated Targets(non-human)

Plasmodium vinckei petteri (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.80Molecular Weight (Monoisotopic): 524.2520AlogP: 5.27#Rotatable Bonds: 14
Polar Surface Area: 48.22Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: -1.34CX LogD: -1.34
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.17Np Likeness Score: 0.07

References

1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S..  (2013)  New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation.,  56  (2): [PMID:23289711] [10.1021/jm3014585]

Source