3,3'-(Naphthalene-1,4-diylbis(butane-4,1-diyl))bis(5-(2-methoxyethyl)-4-methylthiazol-3-ium)Chloride

ID: ALA2314637

PubChem CID: 71521375

Max Phase: Preclinical

Molecular Formula: C32H44Cl2N2O2S2

Molecular Weight: 552.85

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCc1sc[n+](CCCCc2ccc(CCCC[n+]3csc(CCOC)c3C)c3ccccc23)c1C.[Cl-].[Cl-]

Standard InChI:  InChI=1S/C32H44N2O2S2.2ClH/c1-25-31(17-21-35-3)37-23-33(25)19-9-7-11-27-15-16-28(30-14-6-5-13-29(27)30)12-8-10-20-34-24-38-32(26(34)2)18-22-36-4;;/h5-6,13-16,23-24H,7-12,17-22H2,1-4H3;2*1H/q+2;;/p-2

Standard InChI Key:  GVDKXQQKOFYRJQ-UHFFFAOYSA-L

Molfile:  

     RDKit          2D

 40 41  0  0  0  0  0  0  0  0999 V2000
    8.0583  -18.7164    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.1927  -17.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4493  -18.1771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5586  -18.9956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3732  -19.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7600  -18.4158    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.1591  -16.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4285  -16.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3949  -15.7839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6643  -15.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7231  -17.7858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1088  -20.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8229  -20.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8222  -19.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1115  -21.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4144  -21.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9374  -22.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2708  -23.7914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0958  -23.7914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3532  -23.0067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6833  -22.5206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0192  -23.0066    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.0697  -22.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7821  -23.0136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8500  -24.5038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2554  -25.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8358  -25.9327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2412  -26.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5798  -24.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4986  -22.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2111  -23.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6457  -23.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3717  -22.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9525  -21.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6764  -21.3973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6927  -20.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9857  -20.1461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2608  -20.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2481  -21.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2167  -21.8413    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  2  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  3 11  1  0
 12 13  1  0
 13 14  1  0
 14  4  1  0
 15 12  1  0
 16 15  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 20 23  1  0
 23 24  1  0
 18 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 19 29  1  0
 24 30  1  0
 30 31  1  0
 31 17  1  0
 17 32  2  0
 32 33  1  0
 33 16  2  0
 16 35  1  0
 34 17  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 34  2  0
M  CHG  4   1  -1   4   1  20   1  40  -1
M  END

Associated Targets(non-human)

Plasmodium vinckei petteri (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 552.85Molecular Weight (Monoisotopic): 552.2833AlogP: 6.58#Rotatable Bonds: 16
Polar Surface Area: 26.22Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: -0.05CX LogD: -0.05
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.12Np Likeness Score: -0.09

References

1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S..  (2013)  New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation.,  56  (2): [PMID:23289711] [10.1021/jm3014585]

Source