The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,3'-(1,4-Phenylenebis(prop-2-yne-3,1-diyl))bis(5-(2-methoxyethyl)-4-methylthiazol-3-ium)Bromide ID: ALA2314641
PubChem CID: 71521472
Max Phase: Preclinical
Molecular Formula: C26H30Br2N2O2S2
Molecular Weight: 466.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCc1sc[n+](CC#Cc2ccc(C#CC[n+]3csc(CCOC)c3C)cc2)c1C.[Br-].[Br-]
Standard InChI: InChI=1S/C26H30N2O2S2.2BrH/c1-21-25(13-17-29-3)31-19-27(21)15-5-7-23-9-11-24(12-10-23)8-6-16-28-20-32-26(22(28)2)14-18-30-4;;/h9-12,19-20H,13-18H2,1-4H3;2*1H/q+2;;/p-2
Standard InChI Key: ZEEZZKUWWBZLON-UHFFFAOYSA-L
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
12.6089 -30.5397 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
20.6214 -28.8629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8965 -28.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2958 -29.0348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6518 -29.7816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4668 -29.6719 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.2600 -28.3377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1247 -27.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7614 -27.0005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7907 -27.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5697 -28.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7534 -31.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2895 -31.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0529 -31.5330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9871 -30.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1867 -30.5195 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.8288 -31.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9288 -31.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5706 -32.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7484 -32.0856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0961 -32.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9284 -30.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2024 -31.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6357 -31.0888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6655 -29.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9429 -29.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3791 -29.8612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3583 -30.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4791 -31.4540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1018 -29.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8190 -29.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3902 -32.8282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5334 -27.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2549 -27.8246 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 1 0
2 7 1 0
7 8 1 0
8 9 1 0
3 10 1 0
11 4 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
14 17 1 0
12 18 1 0
18 19 1 0
19 20 1 0
13 21 1 0
23 22 1 0
22 24 2 0
24 28 1 0
27 25 1 0
25 26 2 0
26 22 1 0
27 28 2 0
23 29 3 0
29 17 1 0
27 30 1 0
30 31 3 0
31 11 1 0
20 32 1 0
9 33 1 0
M CHG 4 1 -1 4 1 14 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.67Molecular Weight (Monoisotopic): 466.1738AlogP: 3.48#Rotatable Bonds: 8Polar Surface Area: 26.22Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -2.45CX LogD: -2.45Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.38Np Likeness Score: -0.20
References 1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S.. (2013) New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation., 56 (2): [PMID:23289711 ] [10.1021/jm3014585 ]