The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Benzyl-5-(2-(4-(3-(5-(2-methoxyethyl)-4-methylthiazol-3-ium-3-yl)propyl)-1H-1,2,3-triazol-1-yl)ethyl)-4-methylthiazol-3-ium chloride ID: ALA2314646
PubChem CID: 71520836
Max Phase: Preclinical
Molecular Formula: C25H33Cl2N5OS2
Molecular Weight: 483.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCc1sc[n+](CCCc2cn(CCc3sc[n+](Cc4ccccc4)c3C)nn2)c1C.[Cl-].[Cl-]
Standard InChI: InChI=1S/C25H33N5OS2.2ClH/c1-20-25(12-15-31-3)32-18-28(20)13-7-10-23-17-30(27-26-23)14-11-24-21(2)29(19-33-24)16-22-8-5-4-6-9-22;;/h4-6,8-9,17-19H,7,10-16H2,1-3H3;2*1H/q+2;;/p-2
Standard InChI Key: JCIPWVDFJAVUGF-UHFFFAOYSA-L
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
13.2090 -18.7509 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.6049 -20.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4299 -20.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6872 -19.3707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0174 -18.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3524 -19.3710 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.9142 -20.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1974 -20.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3724 -20.8780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9649 -21.5953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4354 -19.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1105 -19.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8589 -19.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5340 -19.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5487 -20.4473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3374 -20.6897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8116 -20.0145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3160 -19.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6366 -20.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0605 -20.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8855 -20.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3830 -21.3525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1635 -21.0849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1502 -20.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3616 -20.0178 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.1423 -22.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1398 -21.6011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8387 -21.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8305 -22.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1128 -22.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1042 -23.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8118 -24.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5295 -23.6131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5347 -22.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5803 -19.2177 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 1 0
3 7 1 0
2 8 1 0
8 9 1 0
9 10 1 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 14 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
22 26 1 0
10 27 1 0
23 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M CHG 4 1 -1 4 1 23 1 35 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.71Molecular Weight (Monoisotopic): 483.2116AlogP: 3.71#Rotatable Bonds: 12Polar Surface Area: 47.70Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.48CX LogP: -2.89CX LogD: -2.89Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.29Np Likeness Score: -0.84
References 1. Caldarelli SA, El Fangour S, Wein S, Tran van Ba C, Périgaud C, Pellet A, Vial HJ, Peyrottes S.. (2013) New bis-thiazolium analogues as potential antimalarial agents: design, synthesis, and biological evaluation., 56 (2): [PMID:23289711 ] [10.1021/jm3014585 ]