The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3-Phenylpropoxy)-2-benzyl-9-isobutyl-1-methyl-beta-carbolinium bromide ID: ALA2314900
PubChem CID: 71575481
Max Phase: Preclinical
Molecular Formula: C32H35BrN2O
Molecular Weight: 463.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c2c(cc[n+]1Cc1ccccc1)c1ccc(OCCCc3ccccc3)cc1n2CC(C)C.[Br-]
Standard InChI: InChI=1S/C32H35N2O.BrH/c1-24(2)22-34-31-21-28(35-20-10-15-26-11-6-4-7-12-26)16-17-29(31)30-18-19-33(25(3)32(30)34)23-27-13-8-5-9-14-27;/h4-9,11-14,16-19,21,24H,10,15,20,22-23H2,1-3H3;1H/q+1;/p-1
Standard InChI Key: LQYKBKZUYWOVHF-UHFFFAOYSA-M
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
8.3576 -15.3781 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
7.1715 -17.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5059 -16.5541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0216 -15.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2112 -15.9790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8809 -16.7263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0996 -16.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3946 -16.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6855 -16.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6855 -17.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3946 -18.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0996 -17.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8809 -18.0479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3570 -17.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6516 -17.9605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2760 -18.7626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9764 -18.2026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2715 -17.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3225 -16.5350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7477 -17.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3520 -17.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7765 -18.6445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5943 -18.6257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9858 -17.9035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5590 -17.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8543 -19.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2497 -20.1778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2729 -16.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5668 -16.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0373 -19.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5654 -15.7536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2698 -15.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2687 -14.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5598 -14.1205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8504 -14.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8550 -15.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
12 13 1 0
13 14 1 0
6 14 2 0
2 14 1 0
2 15 1 0
13 16 1 0
17 18 1 0
10 17 1 0
3 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
16 26 1 0
26 27 1 0
18 28 1 0
29 28 1 0
26 30 1 0
29 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M CHG 2 1 -1 3 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.65Molecular Weight (Monoisotopic): 463.2744AlogP: 7.11#Rotatable Bonds: 9Polar Surface Area: 18.04Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.09CX LogD: 3.09Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -0.18
References 1. Cao R, Fan W, Guo L, Ma Q, Zhang G, Li J, Chen X, Ren Z, Qiu L.. (2013) Synthesis and structure-activity relationships of harmine derivatives as potential antitumor agents., 60 [PMID:23291116 ] [10.1016/j.ejmech.2012.11.045 ]