The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3-Pentyloxy)-9-(3-phenylpropyl)-2-benzyl-1-methyl-beta-carbolinium bromide ID: ALA2314902
PubChem CID: 71575485
Max Phase: Preclinical
Molecular Formula: C33H37BrN2O
Molecular Weight: 477.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(CC)Oc1ccc2c3cc[n+](Cc4ccccc4)c(C)c3n(CCCc3ccccc3)c2c1.[Br-]
Standard InChI: InChI=1S/C33H37N2O.BrH/c1-4-28(5-2)36-29-18-19-30-31-20-22-34(24-27-15-10-7-11-16-27)25(3)33(31)35(32(30)23-29)21-12-17-26-13-8-6-9-14-26;/h6-11,13-16,18-20,22-23,28H,4-5,12,17,21,24H2,1-3H3;1H/q+1;/p-1
Standard InChI Key: BIACKIXQOURAML-UHFFFAOYSA-M
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
9.1005 -18.4405 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
10.5682 -21.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9026 -20.7185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4183 -20.0552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6079 -20.1433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2777 -20.8906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4963 -21.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7913 -20.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0822 -21.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0822 -21.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7913 -22.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4963 -21.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2776 -22.2123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7537 -21.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0483 -22.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6727 -22.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3732 -22.3670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6682 -21.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7192 -20.6994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1444 -21.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7487 -22.1115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1732 -22.8089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9910 -22.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3825 -22.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9557 -21.3735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2510 -23.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4340 -23.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6696 -21.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0123 -24.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1967 -24.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7751 -24.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1705 -25.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9918 -25.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4097 -25.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9626 -20.7314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9598 -22.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2528 -21.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
12 13 1 0
13 14 1 0
6 14 2 0
2 14 1 0
2 15 1 0
13 16 1 0
17 18 1 0
10 17 1 0
3 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
16 26 1 0
26 27 1 0
18 28 1 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
28 35 1 0
18 36 1 0
36 37 1 0
M CHG 2 1 -1 3 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.67Molecular Weight (Monoisotopic): 477.2900AlogP: 7.64#Rotatable Bonds: 10Polar Surface Area: 18.04Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.66CX LogD: 3.66Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.19Np Likeness Score: -0.11
References 1. Cao R, Fan W, Guo L, Ma Q, Zhang G, Li J, Chen X, Ren Z, Qiu L.. (2013) Synthesis and structure-activity relationships of harmine derivatives as potential antitumor agents., 60 [PMID:23291116 ] [10.1016/j.ejmech.2012.11.045 ]